(5Z,8Z,14Z)-5,8,14-Icosatrienoato structure
|
Common Name | (5Z,8Z,14Z)-5,8,14-Icosatrienoato | ||
|---|---|---|---|---|
| CAS Number | 90105-02-5 | Molecular Weight | 306.483 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 437.2±24.0 °C at 760 mmHg | |
| Molecular Formula | C20H34O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 333.9±18.0 °C | |
Use of (5Z,8Z,14Z)-5,8,14-Icosatrienoato5(Z),8(Z),14(Z)-Eicosatrienoic acid is a polyunsaturated fatty acid that can be a substrate for 5-lipoxygenase (5-LO). |
| Name | 5(Z),8(Z),14(Z)-Eicosatrienoic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 437.2±24.0 °C at 760 mmHg |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.483 |
| Flash Point | 333.9±18.0 °C |
| Exact Mass | 306.255890 |
| PSA | 37.30000 |
| LogP | 7.59 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
| Index of Refraction | 1.489 |
| InChIKey | MZHLWKPZCXLYSL-IJJPYCETSA-N |
| SMILES | CCCCCC=CCCCCC=CCC=CCCCC(=O)O |
| 5,8,14-Eicosatrienoic acid, (5Z,8Z,14Z)- |
| (5Z,8Z,14Z)-5,8,14-Icosatrienoato |