D-Glutamic acid alpha-T-butyl-delta-benzyl diester hydrochloride
D-Glutamic acid alpha-T-butyl-delta-benzyl diester hydrochloride structure
|
Common Name | D-Glutamic acid alpha-T-butyl-delta-benzyl diester hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 90159-60-7 | Molecular Weight | 329.81900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H24ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-O-benzyl 1-O-tert-butyl (2R)-2-aminopentanedioate,hydrochloride |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H24ClNO4 |
|---|---|
| Molecular Weight | 329.81900 |
| Exact Mass | 329.13900 |
| PSA | 78.62000 |
| LogP | 3.68130 |
| InChIKey | TWBZXIOAVCJDKR-BTQNPOSSSA-N |
| SMILES | CC(C)(C)OC(=O)C(N)CCC(=O)OCc1ccccc1.Cl |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2922499990 |
|---|
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (R)-5-Benzyl 1-tert-butyl 2-aminopentanedioate hydrochloride |
| D-Glutamic acid alpha-T-butyl-delta-benzyl diester hydrochloride |
| D-Glutamic Acid 1-(1,1-Dimethylethyl) 5-(Phenylmethyl)Ester Hydrochloride |
| H-D-GLU(OBZL)-OTBU HCL |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 5-O-benzyl 1-O-tert-butyl (2R)-2-aminopentanedioate,hydrochloride? |
| A: LogP of 5-O-benzyl 1-O-tert-butyl (2R)-2-aminopentanedioate,hydrochloride is 3.68130. |
| Q: What is the CAS number of 5-O-benzyl 1-O-tert-butyl (2R)-2-aminopentanedioate,hydrochloride? |
| A: CAS number of 5-O-benzyl 1-O-tert-butyl (2R)-2-aminopentanedioate,hydrochloride is 90159-60-7. |
| Q: What is the InChIKey of 5-O-benzyl 1-O-tert-butyl (2R)-2-aminopentanedioate,hydrochloride? |
| A: InChIKey of 5-O-benzyl 1-O-tert-butyl (2R)-2-aminopentanedioate,hydrochloride is TWBZXIOAVCJDKR-BTQNPOSSSA-N. |
| Q: What is the polar surface area (PSA) of 5-O-benzyl 1-O-tert-butyl (2R)-2-aminopentanedioate,hydrochloride? |
| A: Polar surface area (PSA) of 5-O-benzyl 1-O-tert-butyl (2R)-2-aminopentanedioate,hydrochloride is 78.62000. |
| Q: What English synonyms does 5-O-benzyl 1-O-tert-butyl (2R)-2-aminopentanedioate,hydrochloride have? |
| A: English synonyms of 5-O-benzyl 1-O-tert-butyl (2R)-2-aminopentanedioate,hydrochloride: (R)-5-Benzyl 1-tert-butyl 2-aminopentanedioate hydrochloride, D-Glutamic acid alpha-T-butyl-delta-benzyl diester hydrochloride, D-Glutamic Acid 1-(1,1-Dimethylethyl) 5-(Phenylmethyl)Ester Hydrochloride, H-D-GLU(OBZL)-OTBU HCL. |
| Q: What is the SMILES notation of 5-O-benzyl 1-O-tert-butyl (2R)-2-aminopentanedioate,hydrochloride? |
| A: SMILES notation of 5-O-benzyl 1-O-tert-butyl (2R)-2-aminopentanedioate,hydrochloride is CC(C)(C)OC(=O)C(N)CCC(=O)OCc1ccccc1.Cl. |
| Q: What is the English name of 5-O-benzyl 1-O-tert-butyl (2R)-2-aminopentanedioate,hydrochloride? |
| A: The English name of 5-O-benzyl 1-O-tert-butyl (2R)-2-aminopentanedioate,hydrochloride is 5-O-benzyl 1-O-tert-butyl (2R)-2-aminopentanedioate,hydrochloride. |
| Q: What is the molecular formula of 5-O-benzyl 1-O-tert-butyl (2R)-2-aminopentanedioate,hydrochloride? |
| A: Molecular formula of 5-O-benzyl 1-O-tert-butyl (2R)-2-aminopentanedioate,hydrochloride is C16H24ClNO4. |
| Q: What is the molecular weight of 5-O-benzyl 1-O-tert-butyl (2R)-2-aminopentanedioate,hydrochloride? |
| A: Molecular weight of 5-O-benzyl 1-O-tert-butyl (2R)-2-aminopentanedioate,hydrochloride is 329.81900. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |