D-Glutamic acid alpha-T-butyl-delta-benzyl diester hydrochloride structure
|
Common Name | D-Glutamic acid alpha-T-butyl-delta-benzyl diester hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 90159-60-7 | Molecular Weight | 329.81900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H24ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-O-benzyl 1-O-tert-butyl (2R)-2-aminopentanedioate,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H24ClNO4 |
|---|---|
| Molecular Weight | 329.81900 |
| Exact Mass | 329.13900 |
| PSA | 78.62000 |
| LogP | 3.68130 |
| InChIKey | TWBZXIOAVCJDKR-BTQNPOSSSA-N |
| SMILES | CC(C)(C)OC(=O)C(N)CCC(=O)OCc1ccccc1.Cl |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| (R)-5-Benzyl 1-tert-butyl 2-aminopentanedioate hydrochloride |
| D-Glutamic acid alpha-T-butyl-delta-benzyl diester hydrochloride |
| D-Glutamic Acid 1-(1,1-Dimethylethyl) 5-(Phenylmethyl)Ester Hydrochloride |
| H-D-GLU(OBZL)-OTBU HCL |