3-carbamoyl-5-nitrobenzoic acid structure
|
Common Name | 3-carbamoyl-5-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 90196-48-8 | Molecular Weight | 210.14400 | |
| Density | 1.585g/cm3 | Boiling Point | 394.2ºC at 760mmHg | |
| Molecular Formula | C8H6N2O5 | Melting Point | 239-242ºC | |
| MSDS | N/A | Flash Point | 192.2ºC | |
| Name | 3-carbamoyl-5-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.585g/cm3 |
|---|---|
| Boiling Point | 394.2ºC at 760mmHg |
| Melting Point | 239-242ºC |
| Molecular Formula | C8H6N2O5 |
| Molecular Weight | 210.14400 |
| Flash Point | 192.2ºC |
| Exact Mass | 210.02800 |
| PSA | 126.21000 |
| LogP | 1.61540 |
| Index of Refraction | 1.655 |
| InChIKey | BDXFKMQTIGVLEU-UHFFFAOYSA-N |
| SMILES | NC(=O)c1cc(C(=O)O)cc([N+](=O)[O-])c1 |
| HS Code | 2924299090 |
|---|
|
~89%
3-carbamoyl-5-n... CAS#:90196-48-8 |
| Literature: Schering Aktiengesellschaft Patent: EP1186305 A1, 2002 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD00127687 |
| 5-Nitro-isophthalamidsaeure |
| 3-AMINOCARBONYL-5-NITROBENZOIC ACID |
| 5-nitroisophthalamic acid |