1,2-bis(ethenyl)benzene,2-methylprop-2-enoic acid,styrene structure
|
Common Name | 1,2-bis(ethenyl)benzene,2-methylprop-2-enoic acid,styrene | ||
|---|---|---|---|---|
| CAS Number | 9020-13-7 | Molecular Weight | 320.42500 | |
| Density | N/A | Boiling Point | 207.3ºC at 760mmHg | |
| Molecular Formula | C22H24O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 71.9ºC | |
| Name | 1,2-bis(ethenyl)benzene,2-methylprop-2-enoic acid,styrene |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 207.3ºC at 760mmHg |
|---|---|
| Molecular Formula | C22H24O2 |
| Molecular Weight | 320.42500 |
| Flash Point | 71.9ºC |
| Exact Mass | 320.17800 |
| PSA | 37.30000 |
| LogP | 5.94930 |
| InChIKey | QMWYOYYFVYNLJB-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)O.C=Cc1ccccc1.C=Cc1ccccc1C=C |
| 2-Propenoic acid,2-methyl-,polymer with diethenylbenzene and ethenylbenzene |