5,6-Dimethyl-3-phenylpyrazolo[1,5-a]pyrimidin-7-ol
Modify Date: 2026-04-04 09:19:41
![5,6-Dimethyl-3-phenylpyrazolo[1,5-a]pyrimidin-7-ol Structure](https://www.chemsrc.com/extcaspic/274/902008-96-2.png)
5,6-Dimethyl-3-phenylpyrazolo[1,5-a]pyrimidin-7-ol structure
|
Common Name | 5,6-Dimethyl-3-phenylpyrazolo[1,5-a]pyrimidin-7-ol | ||
|---|---|---|---|---|
| CAS Number | 902008-96-2 | Molecular Weight | 239.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H13N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5,6-Dimethyl-3-phenylpyrazolo[1,5-a]pyrimidin-7-ol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H13N3O |
|---|---|
| Molecular Weight | 239.27 |
| InChIKey | CHJUDPKTFRETRI-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C2C(=CNN2C1=O)C3=CC=CC=C3)C |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
|
Name: High Throughput Screening of small molecules that kill Mycobacterium tuberculosis
Source: 15607
Target: N/A
External Id: Cornell_MTB_2017
|
Total 3, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 5,6-Dimethyl-3-phenylpyrazolo[1,5-a]pyrimidin-7-ol? |
| A: The English name of 5,6-Dimethyl-3-phenylpyrazolo[1,5-a]pyrimidin-7-ol is 5,6-Dimethyl-3-phenylpyrazolo[1,5-a]pyrimidin-7-ol. |
| Q: What is the SMILES notation of 5,6-Dimethyl-3-phenylpyrazolo[1,5-a]pyrimidin-7-ol? |
| A: SMILES notation of 5,6-Dimethyl-3-phenylpyrazolo[1,5-a]pyrimidin-7-ol is CC1=C(N=C2C(=CNN2C1=O)C3=CC=CC=C3)C. |
| Q: What is the CAS number of 5,6-Dimethyl-3-phenylpyrazolo[1,5-a]pyrimidin-7-ol? |
| A: CAS number of 5,6-Dimethyl-3-phenylpyrazolo[1,5-a]pyrimidin-7-ol is 902008-96-2. |
| Q: What is the molecular formula of 5,6-Dimethyl-3-phenylpyrazolo[1,5-a]pyrimidin-7-ol? |
| A: Molecular formula of 5,6-Dimethyl-3-phenylpyrazolo[1,5-a]pyrimidin-7-ol is C14H13N3O. |
| Q: What is the molecular weight of 5,6-Dimethyl-3-phenylpyrazolo[1,5-a]pyrimidin-7-ol? |
| A: Molecular weight of 5,6-Dimethyl-3-phenylpyrazolo[1,5-a]pyrimidin-7-ol is 239.27. |
| Q: What is the InChIKey of 5,6-Dimethyl-3-phenylpyrazolo[1,5-a]pyrimidin-7-ol? |
| A: InChIKey of 5,6-Dimethyl-3-phenylpyrazolo[1,5-a]pyrimidin-7-ol is CHJUDPKTFRETRI-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 902008-96-2? |
| A: Chinese name of 902008-96-2 is 902008-96-2. |