5,6-Dimethyl-3-phenylpyrazolo[1,5-a]pyrimidin-7-ol
Modify Date: 2026-04-04 09:19:41
![5,6-Dimethyl-3-phenylpyrazolo[1,5-a]pyrimidin-7-ol Structure](https://www.chemsrc.com/extcaspic/274/902008-96-2.png)
5,6-Dimethyl-3-phenylpyrazolo[1,5-a]pyrimidin-7-ol structure
|
Common Name | 5,6-Dimethyl-3-phenylpyrazolo[1,5-a]pyrimidin-7-ol | ||
|---|---|---|---|---|
| CAS Number | 902008-96-2 | Molecular Weight | 239.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H13N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5,6-Dimethyl-3-phenylpyrazolo[1,5-a]pyrimidin-7-ol |
|---|
| Molecular Formula | C14H13N3O |
|---|---|
| Molecular Weight | 239.27 |
| InChIKey | CHJUDPKTFRETRI-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C2C(=CNN2C1=O)C3=CC=CC=C3)C |
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
|
Name: High Throughput Screening of small molecules that kill Mycobacterium tuberculosis
Source: 15607
Target: N/A
External Id: Cornell_MTB_2017
|
Total 3, Current Page 1 of 1
1