12a-Hydroxy-12,12a-dihydro-1H-1,3,5,5a,11-pentaaza-naphthacene-2,4,6-trione
Modify Date: 2026-08-23 17:02:24
12a-Hydroxy-12,12a-dihydro-1H-1,3,5,5a,11-pentaaza-naphthacene-2,4,6-trione structure
|
Common Name | 12a-Hydroxy-12,12a-dihydro-1H-1,3,5,5a,11-pentaaza-naphthacene-2,4,6-trione | ||
|---|---|---|---|---|
| CAS Number | 902253-92-3 | Molecular Weight | 299.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H9N5O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 12a-Hydroxy-12,12a-dihydro-1H-1,3,5,5a,11-pentaaza-naphthacene-2,4,6-trione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H9N5O4 |
|---|---|
| Molecular Weight | 299.24 |
| InChIKey | PBIODQPTSSMAJW-UHFFFAOYSA-N |
| SMILES | O=C1NC(=O)C2=Nn3c(nc4ccccc4c3=O)CC2(O)N1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 12a-Hydroxy-12,12a-dihydro-1H-1,3,5,5a,11-pentaaza-naphthacene-2,4,6-trione? |
| A: Molecular weight of 12a-Hydroxy-12,12a-dihydro-1H-1,3,5,5a,11-pentaaza-naphthacene-2,4,6-trione is 299.24. |
| Q: What is the SMILES notation of 12a-Hydroxy-12,12a-dihydro-1H-1,3,5,5a,11-pentaaza-naphthacene-2,4,6-trione? |
| A: SMILES notation of 12a-Hydroxy-12,12a-dihydro-1H-1,3,5,5a,11-pentaaza-naphthacene-2,4,6-trione is O=C1NC(=O)C2=Nn3c(nc4ccccc4c3=O)CC2(O)N1. |
| Q: What is the Chinese name of 902253-92-3? |
| A: Chinese name of 902253-92-3 is 902253-92-3. |
| Q: What is the CAS number of 12a-Hydroxy-12,12a-dihydro-1H-1,3,5,5a,11-pentaaza-naphthacene-2,4,6-trione? |
| A: CAS number of 12a-Hydroxy-12,12a-dihydro-1H-1,3,5,5a,11-pentaaza-naphthacene-2,4,6-trione is 902253-92-3. |
| Q: What is the InChIKey of 12a-Hydroxy-12,12a-dihydro-1H-1,3,5,5a,11-pentaaza-naphthacene-2,4,6-trione? |
| A: InChIKey of 12a-Hydroxy-12,12a-dihydro-1H-1,3,5,5a,11-pentaaza-naphthacene-2,4,6-trione is PBIODQPTSSMAJW-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 12a-Hydroxy-12,12a-dihydro-1H-1,3,5,5a,11-pentaaza-naphthacene-2,4,6-trione? |
| A: Molecular formula of 12a-Hydroxy-12,12a-dihydro-1H-1,3,5,5a,11-pentaaza-naphthacene-2,4,6-trione is C13H9N5O4. |
| Q: What is the English name of 12a-Hydroxy-12,12a-dihydro-1H-1,3,5,5a,11-pentaaza-naphthacene-2,4,6-trione? |
| A: The English name of 12a-Hydroxy-12,12a-dihydro-1H-1,3,5,5a,11-pentaaza-naphthacene-2,4,6-trione is 12a-Hydroxy-12,12a-dihydro-1H-1,3,5,5a,11-pentaaza-naphthacene-2,4,6-trione. |