3-[[[2-[(Aminoiminomethyl)amino]-4-thiazolyl]methyl]sulfinyl]-N-(aminosulfonyl)propanimidamide structure
|
Common Name | 3-[[[2-[(Aminoiminomethyl)amino]-4-thiazolyl]methyl]sulfinyl]-N-(aminosulfonyl)propanimidamide | ||
|---|---|---|---|---|
| CAS Number | 90237-03-9 | Molecular Weight | 353.44500 | |
| Density | 1.98±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H15N7O3S3 | Melting Point | 85-95°C dec. | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [(2-Carbamimidamido-1,3-thiazol-4-yl)methyl][3-imino-3-(sulfamoyl amino)propyl]sulfoniumolate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.98±0.1 g/cm3 |
|---|---|
| Melting Point | 85-95°C dec. |
| Molecular Formula | C8H15N7O3S3 |
| Molecular Weight | 353.44500 |
| Exact Mass | 353.04000 |
| PSA | 243.73000 |
| LogP | 2.86810 |
| InChIKey | LAZSSGBZNCVJCB-UHFFFAOYSA-N |
| SMILES | NC(N)=Nc1nc(CS(=O)CCC(N)=NS(N)(=O)=O)cs1 |
| Storage condition | -20°C Freezer |
| Water Solubility | Slightly soluble (2.7 g/L) |
| RIDADR | NONH for all modes of transport |
|---|
|
~%
3-[[[2-[(Aminoi... CAS#:90237-03-9 |
| Literature: Yanagisawa, Isao; Hirata, Yasufumi; Ishii, Yoshio Journal of Medicinal Chemistry, 1987 , vol. 30, # 10 p. 1787 - 1793 |
|
~%
3-[[[2-[(Aminoi... CAS#:90237-03-9 |
| Literature: Yanagisawa, Isao; Hirata, Yasufumi; Ishii, Yoshio Journal of Medicinal Chemistry, 1987 , vol. 30, # 10 p. 1787 - 1793 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Name: Histamine H2 receptor antagonist activity (chronotropic response to histamine) in gui...
Source: ChEMBL
Target: Histamine H2 receptor
External Id: CHEMBL695955
|
|
Name: Reduction in gastric acid secretion under histamine[160 ug/(kg h)] stimulation in ane...
Source: ChEMBL
Target: Canis lupus familiaris
External Id: CHEMBL672826
|
| ganor |
| muclox |
| gaster |
| peptan |
| Ifada |
| motiax |
| pepcid |
| fibonel |
| pepdul |
| 3-[[[2-[(Aminoiminomethyl)amino]-4-thiazolyl]methyl]sulfinyl]-N-(aminosulfonyl)propanimidamide |
| Famotidine Impurity 10 |