1,2,3,4-Tetrahydro-1,8,10-trimethylpyrazino(1,2-a)indole hydrochloride
Modify Date: 2026-07-06 10:33:03
1,2,3,4-Tetrahydro-1,8,10-trimethylpyrazino(1,2-a)indole hydrochloride structure
|
Common Name | 1,2,3,4-Tetrahydro-1,8,10-trimethylpyrazino(1,2-a)indole hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 90237-32-4 | Molecular Weight | 250.77 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H19ClN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,2,3,4-Tetrahydro-1,8,10-trimethylpyrazino(1,2-a)indole hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H19ClN2 |
|---|---|
| Molecular Weight | 250.77 |
| InChIKey | GDJTUYRHECCGMQ-UHFFFAOYSA-N |
| SMILES | Cc1ccc2c(c1)c(C)c1n2CCNC1C.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 90237-32-4? |
| A: Chinese name of 90237-32-4 is 90237-32-4. |
| Q: What is the CAS number of 1,2,3,4-Tetrahydro-1,8,10-trimethylpyrazino(1,2-a)indole hydrochloride? |
| A: CAS number of 1,2,3,4-Tetrahydro-1,8,10-trimethylpyrazino(1,2-a)indole hydrochloride is 90237-32-4. |
| Q: What is the English name of 1,2,3,4-Tetrahydro-1,8,10-trimethylpyrazino(1,2-a)indole hydrochloride? |
| A: The English name of 1,2,3,4-Tetrahydro-1,8,10-trimethylpyrazino(1,2-a)indole hydrochloride is 1,2,3,4-Tetrahydro-1,8,10-trimethylpyrazino(1,2-a)indole hydrochloride. |
| Q: What is the InChIKey of 1,2,3,4-Tetrahydro-1,8,10-trimethylpyrazino(1,2-a)indole hydrochloride? |
| A: InChIKey of 1,2,3,4-Tetrahydro-1,8,10-trimethylpyrazino(1,2-a)indole hydrochloride is GDJTUYRHECCGMQ-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1,2,3,4-Tetrahydro-1,8,10-trimethylpyrazino(1,2-a)indole hydrochloride? |
| A: Molecular formula of 1,2,3,4-Tetrahydro-1,8,10-trimethylpyrazino(1,2-a)indole hydrochloride is C14H19ClN2. |
| Q: What is the molecular weight of 1,2,3,4-Tetrahydro-1,8,10-trimethylpyrazino(1,2-a)indole hydrochloride? |
| A: Molecular weight of 1,2,3,4-Tetrahydro-1,8,10-trimethylpyrazino(1,2-a)indole hydrochloride is 250.77. |
| Q: What is the SMILES notation of 1,2,3,4-Tetrahydro-1,8,10-trimethylpyrazino(1,2-a)indole hydrochloride? |
| A: SMILES notation of 1,2,3,4-Tetrahydro-1,8,10-trimethylpyrazino(1,2-a)indole hydrochloride is Cc1ccc2c(c1)c(C)c1n2CCNC1C.Cl. |