methyl 2-azido-3-methoxypropanoate
methyl 2-azido-3-methoxypropanoate structure
|
Common Name | methyl 2-azido-3-methoxypropanoate | ||
|---|---|---|---|---|
| CAS Number | 90237-75-5 | Molecular Weight | 159.14300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5H9N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 2-azido-3-methoxypropanoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C5H9N3O3 |
|---|---|
| Molecular Weight | 159.14300 |
| Exact Mass | 159.06400 |
| PSA | 85.28000 |
| InChIKey | KSPJELWWGOKVAB-UHFFFAOYSA-N |
| SMILES | COCC(N=[N+]=[N-])C(=O)OC |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~96%
methyl 2-azido-... CAS#:90237-75-5 |
| Literature: Effenberger, Franz; Zoller, Gerhard Tetrahedron, 1988 , vol. 44, # 17 p. 5573 - 5582 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Propanoic acid,2-azido-3-methoxy-,methyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 90237-75-5? |
| A: Chinese name of 90237-75-5 is 90237-75-5. |
| Q: What is the CAS number of methyl 2-azido-3-methoxypropanoate? |
| A: CAS number of methyl 2-azido-3-methoxypropanoate is 90237-75-5. |
| Q: What is the polar surface area (PSA) of methyl 2-azido-3-methoxypropanoate? |
| A: Polar surface area (PSA) of methyl 2-azido-3-methoxypropanoate is 85.28000. |
| Q: What is the molecular weight of methyl 2-azido-3-methoxypropanoate? |
| A: Molecular weight of methyl 2-azido-3-methoxypropanoate is 159.14300. |
| Q: What is the molecular formula of methyl 2-azido-3-methoxypropanoate? |
| A: Molecular formula of methyl 2-azido-3-methoxypropanoate is C5H9N3O3. |
| Q: What is the English name of methyl 2-azido-3-methoxypropanoate? |
| A: The English name of methyl 2-azido-3-methoxypropanoate is methyl 2-azido-3-methoxypropanoate. |
| Q: What is the SMILES notation of methyl 2-azido-3-methoxypropanoate? |
| A: SMILES notation of methyl 2-azido-3-methoxypropanoate is COCC(N=[N+]=[N-])C(=O)OC. |
| Q: What is the InChIKey of methyl 2-azido-3-methoxypropanoate? |
| A: InChIKey of methyl 2-azido-3-methoxypropanoate is KSPJELWWGOKVAB-UHFFFAOYSA-N. |
| Q: What English synonyms does methyl 2-azido-3-methoxypropanoate have? |
| A: English synonyms of methyl 2-azido-3-methoxypropanoate: Propanoic acid,2-azido-3-methoxy-,methyl ester. |