N-benzyl-2-(diacetylamino)hex-2-enamide
N-benzyl-2-(diacetylamino)hex-2-enamide structure
|
Common Name | N-benzyl-2-(diacetylamino)hex-2-enamide | ||
|---|---|---|---|---|
| CAS Number | 90237-90-4 | Molecular Weight | 302.36800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H22N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-benzyl-2-(diacetylamino)hex-2-enamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H22N2O3 |
|---|---|
| Molecular Weight | 302.36800 |
| Exact Mass | 302.16300 |
| PSA | 69.97000 |
| LogP | 3.22210 |
| InChIKey | BEKSEVGTJSGHTQ-UHFFFAOYSA-N |
| SMILES | CCCC=C(C(=O)NCc1ccccc1)N(C(C)=O)C(C)=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
N-benzyl-2-(dia... CAS#:90237-90-4 |
| Literature: Beisswenger, Thomas; Effenberger, Franz Chemische Berichte, 1984 , vol. 117, # 4 p. 1513 - 1522 |
|
~%
N-benzyl-2-(dia... CAS#:90237-90-4 |
| Literature: Beisswenger, Thomas; Effenberger, Franz Chemische Berichte, 1984 , vol. 117, # 4 p. 1513 - 1522 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Hexenamide,2-(diacetylamino)-N-(phenylmethyl) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of N-benzyl-2-(diacetylamino)hex-2-enamide? |
| A: CAS number of N-benzyl-2-(diacetylamino)hex-2-enamide is 90237-90-4. |
| Q: What is the InChIKey of N-benzyl-2-(diacetylamino)hex-2-enamide? |
| A: InChIKey of N-benzyl-2-(diacetylamino)hex-2-enamide is BEKSEVGTJSGHTQ-UHFFFAOYSA-N. |
| Q: What is the molecular formula of N-benzyl-2-(diacetylamino)hex-2-enamide? |
| A: Molecular formula of N-benzyl-2-(diacetylamino)hex-2-enamide is C17H22N2O3. |
| Q: What is the English name of N-benzyl-2-(diacetylamino)hex-2-enamide? |
| A: The English name of N-benzyl-2-(diacetylamino)hex-2-enamide is N-benzyl-2-(diacetylamino)hex-2-enamide. |
| Q: What is the polar surface area (PSA) of N-benzyl-2-(diacetylamino)hex-2-enamide? |
| A: Polar surface area (PSA) of N-benzyl-2-(diacetylamino)hex-2-enamide is 69.97000. |
| Q: What is the LogP of N-benzyl-2-(diacetylamino)hex-2-enamide? |
| A: LogP of N-benzyl-2-(diacetylamino)hex-2-enamide is 3.22210. |
| Q: What English synonyms does N-benzyl-2-(diacetylamino)hex-2-enamide have? |
| A: English synonyms of N-benzyl-2-(diacetylamino)hex-2-enamide: 2-Hexenamide,2-(diacetylamino)-N-(phenylmethyl). |
| Q: What is the molecular weight of N-benzyl-2-(diacetylamino)hex-2-enamide? |
| A: Molecular weight of N-benzyl-2-(diacetylamino)hex-2-enamide is 302.36800. |
| Q: What is the SMILES notation of N-benzyl-2-(diacetylamino)hex-2-enamide? |
| A: SMILES notation of N-benzyl-2-(diacetylamino)hex-2-enamide is CCCC=C(C(=O)NCc1ccccc1)N(C(C)=O)C(C)=O. |
| Q: What is the Chinese name of 90237-90-4? |
| A: Chinese name of 90237-90-4 is 90237-90-4. |