Butanamide, 2,2'-[(3,3'-dichloro[1,1'-biphenyl]-4,4'-diyl)bis(azo)]bis[3-oxo-, N,N'-bis(4-chloro-2,5-dimethoxyphenyl and 2,4-xylyl) derivs. structure
|
Common Name | Butanamide, 2,2'-[(3,3'-dichloro[1,1'-biphenyl]-4,4'-diyl)bis(azo)]bis[3-oxo-, N,N'-bis(4-chloro-2,5-dimethoxyphenyl and 2,4-xylyl) derivs. | ||
|---|---|---|---|---|
| CAS Number | 90268-24-9 | Molecular Weight | 752.043 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 838.6±65.0 °C at 760 mmHg | |
| Molecular Formula | C36H33Cl3N6O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 461.0±34.3 °C | |
| Name | 2-[(E)-{3,3'-Dichloro-4'-[(E)-{1-[(4-chloro-2,5-dimethoxyphenyl)amino]-1,3-dioxo-2-butanyl}diazenyl]-4-biphenylyl}diazenyl]-N-(2,4-dimethylphenyl)-3-oxobutanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 838.6±65.0 °C at 760 mmHg |
| Molecular Formula | C36H33Cl3N6O6 |
| Molecular Weight | 752.043 |
| Flash Point | 461.0±34.3 °C |
| Exact Mass | 750.152710 |
| LogP | 9.50 |
| Vapour Pressure | 0.0±3.1 mmHg at 25°C |
| Index of Refraction | 1.630 |
| InChIKey | CTCGHGAGCLXAHB-UHFFFAOYSA-N |
| SMILES | COc1cc(NC(=O)C(N=Nc2ccc(-c3ccc(N=NC(C(C)=O)C(=O)Nc4ccc(C)cc4C)c(Cl)c3)cc2Cl)C(C)=O)c(OC)cc1Cl |
| MFCD22380679 |
| 2-[(E)-{3,3'-Dichloro-4'-[(E)-{1-[(4-chloro-2,5-dimethoxyphenyl)amino]-1,3-dioxo-2-butanyl}diazenyl]-4-biphenylyl}diazenyl]-N-(2,4-dimethylphenyl)-3-oxobutanamide |
| Butanamide, 2-[(E)-2-[3,3'-dichloro-4'-[(E)-2-[1-[[(4-chloro-2,5-dimethoxyphenyl)amino]carbonyl]-2-oxopropyl]diazenyl][1,1'-biphenyl]-4-yl]diazenyl]-N-(2,4-dimethylphenyl)-3-oxo- |