methyl 3-bromo-2,5,5-trimethyl-4-oxohexanoate
methyl 3-bromo-2,5,5-trimethyl-4-oxohexanoate structure
|
Common Name | methyl 3-bromo-2,5,5-trimethyl-4-oxohexanoate | ||
|---|---|---|---|---|
| CAS Number | 90289-09-1 | Molecular Weight | 265.14400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H17BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 3-bromo-2,5,5-trimethyl-4-oxohexanoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H17BrO3 |
|---|---|
| Molecular Weight | 265.14400 |
| Exact Mass | 264.03600 |
| PSA | 43.37000 |
| LogP | 2.17420 |
| InChIKey | YDYRCSQVEROUBM-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C)C(Br)C(=O)C(C)(C)C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~91%
methyl 3-bromo-... CAS#:90289-09-1 |
| Literature: Reichelt, Ingrid; Reissig, Hans-Ulrich Liebigs Annalen der Chemie, 1984 , # 4 p. 820 - 827 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Hexanoic acid,3-bromo-2,5,5-trimethyl-4-oxo-,methyl ester |
| 3-Brom-2,5,5-trimethyl-4-oxohexansaeure-methylester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of methyl 3-bromo-2,5,5-trimethyl-4-oxohexanoate? |
| A: Molecular weight of methyl 3-bromo-2,5,5-trimethyl-4-oxohexanoate is 265.14400. |
| Q: What is the polar surface area (PSA) of methyl 3-bromo-2,5,5-trimethyl-4-oxohexanoate? |
| A: Polar surface area (PSA) of methyl 3-bromo-2,5,5-trimethyl-4-oxohexanoate is 43.37000. |
| Q: What is the molecular formula of methyl 3-bromo-2,5,5-trimethyl-4-oxohexanoate? |
| A: Molecular formula of methyl 3-bromo-2,5,5-trimethyl-4-oxohexanoate is C10H17BrO3. |
| Q: What English synonyms does methyl 3-bromo-2,5,5-trimethyl-4-oxohexanoate have? |
| A: English synonyms of methyl 3-bromo-2,5,5-trimethyl-4-oxohexanoate: Hexanoic acid,3-bromo-2,5,5-trimethyl-4-oxo-,methyl ester, 3-Brom-2,5,5-trimethyl-4-oxohexansaeure-methylester. |
| Q: What is the CAS number of methyl 3-bromo-2,5,5-trimethyl-4-oxohexanoate? |
| A: CAS number of methyl 3-bromo-2,5,5-trimethyl-4-oxohexanoate is 90289-09-1. |
| Q: What is the LogP of methyl 3-bromo-2,5,5-trimethyl-4-oxohexanoate? |
| A: LogP of methyl 3-bromo-2,5,5-trimethyl-4-oxohexanoate is 2.17420. |
| Q: What is the Chinese name of 90289-09-1? |
| A: Chinese name of 90289-09-1 is 90289-09-1. |
| Q: What is the InChIKey of methyl 3-bromo-2,5,5-trimethyl-4-oxohexanoate? |
| A: InChIKey of methyl 3-bromo-2,5,5-trimethyl-4-oxohexanoate is YDYRCSQVEROUBM-UHFFFAOYSA-N. |
| Q: What is the English name of methyl 3-bromo-2,5,5-trimethyl-4-oxohexanoate? |
| A: The English name of methyl 3-bromo-2,5,5-trimethyl-4-oxohexanoate is methyl 3-bromo-2,5,5-trimethyl-4-oxohexanoate. |
| Q: What is the SMILES notation of methyl 3-bromo-2,5,5-trimethyl-4-oxohexanoate? |
| A: SMILES notation of methyl 3-bromo-2,5,5-trimethyl-4-oxohexanoate is COC(=O)C(C)C(Br)C(=O)C(C)(C)C. |