[(2,2-Dichlorocyclopropyl)sulfinyl]benzene
Modify Date: 2026-08-16 23:37:59
![[(2,2-Dichlorocyclopropyl)sulfinyl]benzene Structure](https://www.chemsrc.com/extcaspic/451/90348-57-5.png)
[(2,2-Dichlorocyclopropyl)sulfinyl]benzene structure
|
Common Name | [(2,2-Dichlorocyclopropyl)sulfinyl]benzene | ||
|---|---|---|---|---|
| CAS Number | 90348-57-5 | Molecular Weight | 235.13 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H8Cl2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [(2,2-Dichlorocyclopropyl)sulfinyl]benzene |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H8Cl2OS |
|---|---|
| Molecular Weight | 235.13 |
| InChIKey | ZSAZDIADOYWYKD-UHFFFAOYSA-N |
| SMILES | O=S(c1ccccc1)C1CC1(Cl)Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of [(2,2-Dichlorocyclopropyl)sulfinyl]benzene? |
| A: Molecular formula of [(2,2-Dichlorocyclopropyl)sulfinyl]benzene is C9H8Cl2OS. |
| Q: What is the molecular weight of [(2,2-Dichlorocyclopropyl)sulfinyl]benzene? |
| A: Molecular weight of [(2,2-Dichlorocyclopropyl)sulfinyl]benzene is 235.13. |
| Q: What is the Chinese name of 90348-57-5? |
| A: Chinese name of 90348-57-5 is 90348-57-5. |
| Q: What is the CAS number of [(2,2-Dichlorocyclopropyl)sulfinyl]benzene? |
| A: CAS number of [(2,2-Dichlorocyclopropyl)sulfinyl]benzene is 90348-57-5. |
| Q: What is the SMILES notation of [(2,2-Dichlorocyclopropyl)sulfinyl]benzene? |
| A: SMILES notation of [(2,2-Dichlorocyclopropyl)sulfinyl]benzene is O=S(c1ccccc1)C1CC1(Cl)Cl. |
| Q: What is the InChIKey of [(2,2-Dichlorocyclopropyl)sulfinyl]benzene? |
| A: InChIKey of [(2,2-Dichlorocyclopropyl)sulfinyl]benzene is ZSAZDIADOYWYKD-UHFFFAOYSA-N. |
| Q: What is the English name of [(2,2-Dichlorocyclopropyl)sulfinyl]benzene? |
| A: The English name of [(2,2-Dichlorocyclopropyl)sulfinyl]benzene is [(2,2-Dichlorocyclopropyl)sulfinyl]benzene. |