Ethanone,1-(3,5-dichloro-2-hydroxy-6-methylphenyl)- structure
|
Common Name | Ethanone,1-(3,5-dichloro-2-hydroxy-6-methylphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 90348-61-1 | Molecular Weight | 219.06500 | |
| Density | 1.372g/cm3 | Boiling Point | 314ºC at 760 mmHg | |
| Molecular Formula | C9H8Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 143.7ºC | |
| Name | 1-(3,5-dichloro-2-hydroxy-6-methylphenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.372g/cm3 |
|---|---|
| Boiling Point | 314ºC at 760 mmHg |
| Molecular Formula | C9H8Cl2O2 |
| Molecular Weight | 219.06500 |
| Flash Point | 143.7ºC |
| Exact Mass | 217.99000 |
| PSA | 37.30000 |
| LogP | 3.21000 |
| Index of Refraction | 1.575 |
| InChIKey | XZJZDWLTPWIMHM-UHFFFAOYSA-N |
| SMILES | CC(=O)c1c(C)c(Cl)cc(Cl)c1O |
|
~%
Ethanone,1-(3,5... CAS#:90348-61-1 |
| Literature: Cremer,S.E.; Tarbell,D.S. Journal of Organic Chemistry, 1961 , vol. 26, p. 3653 - 3657 |
|
~%
Ethanone,1-(3,5... CAS#:90348-61-1 |
| Literature: Cremer,S.E.; Tarbell,D.S. Journal of Organic Chemistry, 1961 , vol. 26, p. 3653 - 3657 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| 3,5-Dichlor-2-hydroxy-6-methyl-acetophenon |