Benzoic acid, 3,5-dichloro-2-methoxy-4-methyl
Modify Date: 2026-08-29 22:13:34
Benzoic acid, 3,5-dichloro-2-methoxy-4-methyl structure
|
Common Name | Benzoic acid, 3,5-dichloro-2-methoxy-4-methyl | ||
|---|---|---|---|---|
| CAS Number | 90348-70-2 | Molecular Weight | 235.06 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H8Cl2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzoic acid, 3,5-dichloro-2-methoxy-4-methyl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H8Cl2O3 |
|---|---|
| Molecular Weight | 235.06 |
| InChIKey | LGAKAUMANPLZQR-UHFFFAOYSA-N |
| SMILES | COc1c(C(=O)O)cc(Cl)c(C)c1Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Benzoic acid, 3,5-dichloro-2-methoxy-4-methyl? |
| A: CAS number of Benzoic acid, 3,5-dichloro-2-methoxy-4-methyl is 90348-70-2. |
| Q: What is the InChIKey of Benzoic acid, 3,5-dichloro-2-methoxy-4-methyl? |
| A: InChIKey of Benzoic acid, 3,5-dichloro-2-methoxy-4-methyl is LGAKAUMANPLZQR-UHFFFAOYSA-N. |
| Q: What is the molecular formula of Benzoic acid, 3,5-dichloro-2-methoxy-4-methyl? |
| A: Molecular formula of Benzoic acid, 3,5-dichloro-2-methoxy-4-methyl is C9H8Cl2O3. |
| Q: What is the Chinese name of 90348-70-2? |
| A: Chinese name of 90348-70-2 is 90348-70-2. |
| Q: What is the molecular weight of Benzoic acid, 3,5-dichloro-2-methoxy-4-methyl? |
| A: Molecular weight of Benzoic acid, 3,5-dichloro-2-methoxy-4-methyl is 235.06. |
| Q: What is the SMILES notation of Benzoic acid, 3,5-dichloro-2-methoxy-4-methyl? |
| A: SMILES notation of Benzoic acid, 3,5-dichloro-2-methoxy-4-methyl is COc1c(C(=O)O)cc(Cl)c(C)c1Cl. |
| Q: What is the English name of Benzoic acid, 3,5-dichloro-2-methoxy-4-methyl? |
| A: The English name of Benzoic acid, 3,5-dichloro-2-methoxy-4-methyl is Benzoic acid, 3,5-dichloro-2-methoxy-4-methyl. |