((2R,5R,Z)-Hex-3-ene-2,5-diyl)bis(bis(3,5-dimethylphenyl)phosphane)
Modify Date: 2026-07-17 15:39:36
((2R,5R,Z)-Hex-3-ene-2,5-diyl)bis(bis(3,5-dimethylphenyl)phosphane) structure
|
Common Name | ((2R,5R,Z)-Hex-3-ene-2,5-diyl)bis(bis(3,5-dimethylphenyl)phosphane) | ||
|---|---|---|---|---|
| CAS Number | 903529-07-7 | Molecular Weight | 564.7 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C38H46P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ((2R,5R,Z)-Hex-3-ene-2,5-diyl)bis(bis(3,5-dimethylphenyl)phosphane) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C38H46P2 |
|---|---|
| Molecular Weight | 564.7 |
| InChIKey | IIUHSJAXQHDYHV-FUTAZXAUSA-N |
| SMILES | Cc1cc(C)cc(P(c2cc(C)cc(C)c2)C(C)C=CC(C)P(c2cc(C)cc(C)c2)c2cc(C)cc(C)c2)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 903529-07-7? |
| A: Chinese name of 903529-07-7 is 903529-07-7. |
| Q: What is the CAS number of ((2R,5R,Z)-Hex-3-ene-2,5-diyl)bis(bis(3,5-dimethylphenyl)phosphane)? |
| A: CAS number of ((2R,5R,Z)-Hex-3-ene-2,5-diyl)bis(bis(3,5-dimethylphenyl)phosphane) is 903529-07-7. |
| Q: What is the molecular formula of ((2R,5R,Z)-Hex-3-ene-2,5-diyl)bis(bis(3,5-dimethylphenyl)phosphane)? |
| A: Molecular formula of ((2R,5R,Z)-Hex-3-ene-2,5-diyl)bis(bis(3,5-dimethylphenyl)phosphane) is C38H46P2. |
| Q: What is the SMILES notation of ((2R,5R,Z)-Hex-3-ene-2,5-diyl)bis(bis(3,5-dimethylphenyl)phosphane)? |
| A: SMILES notation of ((2R,5R,Z)-Hex-3-ene-2,5-diyl)bis(bis(3,5-dimethylphenyl)phosphane) is Cc1cc(C)cc(P(c2cc(C)cc(C)c2)C(C)C=CC(C)P(c2cc(C)cc(C)c2)c2cc(C)cc(C)c2)c1. |
| Q: What is the English name of ((2R,5R,Z)-Hex-3-ene-2,5-diyl)bis(bis(3,5-dimethylphenyl)phosphane)? |
| A: The English name of ((2R,5R,Z)-Hex-3-ene-2,5-diyl)bis(bis(3,5-dimethylphenyl)phosphane) is ((2R,5R,Z)-Hex-3-ene-2,5-diyl)bis(bis(3,5-dimethylphenyl)phosphane). |
| Q: What is the InChIKey of ((2R,5R,Z)-Hex-3-ene-2,5-diyl)bis(bis(3,5-dimethylphenyl)phosphane)? |
| A: InChIKey of ((2R,5R,Z)-Hex-3-ene-2,5-diyl)bis(bis(3,5-dimethylphenyl)phosphane) is IIUHSJAXQHDYHV-FUTAZXAUSA-N. |
| Q: What is the molecular weight of ((2R,5R,Z)-Hex-3-ene-2,5-diyl)bis(bis(3,5-dimethylphenyl)phosphane)? |
| A: Molecular weight of ((2R,5R,Z)-Hex-3-ene-2,5-diyl)bis(bis(3,5-dimethylphenyl)phosphane) is 564.7. |