N-[4-Cyano-3-(trifluoromethyl)phenyl]-2-hydroxy-2-methyl-3-(methylthio)propanamide structure
|
Common Name | N-[4-Cyano-3-(trifluoromethyl)phenyl]-2-hydroxy-2-methyl-3-(methylthio)propanamide | ||
|---|---|---|---|---|
| CAS Number | 90356-10-8 | Molecular Weight | 318.32 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H13F3N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[4-Cyano-3-(trifluoromethyl)phenyl]-2-hydroxy-2-methyl-3-(methylthio)propanamide |
|---|
| Molecular Formula | C13H13F3N2O2S |
|---|---|
| Molecular Weight | 318.32 |
| InChIKey | GVPLVFFPRYVRJJ-UHFFFAOYSA-N |
| SMILES | CSCC(C)(O)C(=O)Nc1ccc(C#N)c(C(F)(F)F)c1 |
|
Name: Agonist activity indicated by a statistically significant increase in ventral prostat...
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL796442
|
|
Name: Effective dose required to inhibit 50 percent of androgen hormone activity in intact ...
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL781245
|