2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]oxirane-2-carboxamide
![2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]oxirane-2-carboxamide Structure](https://image.chemsrc.com/caspic/258/90357-50-9.png)
2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]oxirane-2-carboxamide structure
|
Common Name | 2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]oxirane-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 90357-50-9 | Molecular Weight | 290.19500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H9F3N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]oxirane-2-carboxamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H9F3N2O4 |
|---|---|
| Molecular Weight | 290.19500 |
| Exact Mass | 290.05100 |
| PSA | 90.94000 |
| LogP | 3.51370 |
| InChIKey | MXYYQYGACYMJDH-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)Nc2ccc([N+](=O)[O-])c(C(F)(F)F)c2)CO1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-nitro-3-trifluoromethyl-N-[2,3-epoxy-2-methyl propionyl]aniline |
| N-(4-nitro-3-trifluoromethyl-phenyl)-methyl-oxiranyl-carboxamide |
| N-(2,3-epoxy-2-methylpropionyl)-4-nitro-3-trifluoromethylaniline |
| Oxiranecarboxamide,2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl] |
| 1,2-epoxy-2-methyl-N-<4-nitro-3-(trifluoromethyl)phenyl>propanamide |
| N-(4-nitro-3-trifluoromethylphenyl)-2-methyl-oxiranyl-carboxamide |
| rac-2-methyl-N-(4-nitro-3-(trifluoromethyl)phenyl)oxirane-2-carboxamide |
| N-(4-nitro-3-(trifluoromethyl)phenyl)-2-methyloxirane-2-carboxamide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]oxirane-2-carboxamide? |
| A: CAS number of 2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]oxirane-2-carboxamide is 90357-50-9. |
| Q: What is the molecular formula of 2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]oxirane-2-carboxamide? |
| A: Molecular formula of 2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]oxirane-2-carboxamide is C11H9F3N2O4. |
| Q: What is the Chinese name of 90357-50-9? |
| A: Chinese name of 90357-50-9 is 90357-50-9. |
| Q: What is the molecular weight of 2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]oxirane-2-carboxamide? |
| A: Molecular weight of 2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]oxirane-2-carboxamide is 290.19500. |
| Q: What is the LogP of 2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]oxirane-2-carboxamide? |
| A: LogP of 2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]oxirane-2-carboxamide is 3.51370. |
| Q: What is the polar surface area (PSA) of 2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]oxirane-2-carboxamide? |
| A: Polar surface area (PSA) of 2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]oxirane-2-carboxamide is 90.94000. |
| Q: What is the English name of 2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]oxirane-2-carboxamide? |
| A: The English name of 2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]oxirane-2-carboxamide is 2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]oxirane-2-carboxamide. |
| Q: What is the SMILES notation of 2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]oxirane-2-carboxamide? |
| A: SMILES notation of 2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]oxirane-2-carboxamide is CC1(C(=O)Nc2ccc([N+](=O)[O-])c(C(F)(F)F)c2)CO1. |
| Q: What is the InChIKey of 2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]oxirane-2-carboxamide? |
| A: InChIKey of 2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]oxirane-2-carboxamide is MXYYQYGACYMJDH-UHFFFAOYSA-N. |