Cyclohexanamine hemi((2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl phosphonate)
Modify Date: 2026-07-10 17:57:59
Cyclohexanamine hemi((2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl phosphonate) structure
|
Common Name | Cyclohexanamine hemi((2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl phosphonate) | ||
|---|---|---|---|---|
| CAS Number | 90357-92-9 | Molecular Weight | 441.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H38N2O8P+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Cyclohexanamine hemi((2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl phosphonate) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H38N2O8P+ |
|---|---|
| Molecular Weight | 441.5 |
| InChIKey | JZCSAKWYEPUSMT-LODRDNNTSA-O |
| SMILES | NC1CCCCC1.NC1CCCCC1.O=[P+](O)OC1OC(CO)C(O)C(O)C1O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Cyclohexanamine hemi((2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl phosphonate)? |
| A: The English name of Cyclohexanamine hemi((2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl phosphonate) is Cyclohexanamine hemi((2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl phosphonate). |
| Q: What is the InChIKey of Cyclohexanamine hemi((2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl phosphonate)? |
| A: InChIKey of Cyclohexanamine hemi((2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl phosphonate) is JZCSAKWYEPUSMT-LODRDNNTSA-O. |
| Q: What is the SMILES notation of Cyclohexanamine hemi((2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl phosphonate)? |
| A: SMILES notation of Cyclohexanamine hemi((2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl phosphonate) is NC1CCCCC1.NC1CCCCC1.O=[P+](O)OC1OC(CO)C(O)C(O)C1O. |
| Q: What is the molecular formula of Cyclohexanamine hemi((2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl phosphonate)? |
| A: Molecular formula of Cyclohexanamine hemi((2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl phosphonate) is C18H38N2O8P+. |
| Q: What is the Chinese name of 90357-92-9? |
| A: Chinese name of 90357-92-9 is 90357-92-9. |
| Q: What is the molecular weight of Cyclohexanamine hemi((2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl phosphonate)? |
| A: Molecular weight of Cyclohexanamine hemi((2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl phosphonate) is 441.5. |
| Q: What is the CAS number of Cyclohexanamine hemi((2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl phosphonate)? |
| A: CAS number of Cyclohexanamine hemi((2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl phosphonate) is 90357-92-9. |