4,4-dioxo-2,3-dihydrobenzo[f]thiochromen-1-one
![4,4-dioxo-2,3-dihydrobenzo[f]thiochromen-1-one Structure](https://image.chemsrc.com/caspic/307/90396-07-9.png)
4,4-dioxo-2,3-dihydrobenzo[f]thiochromen-1-one structure
|
Common Name | 4,4-dioxo-2,3-dihydrobenzo[f]thiochromen-1-one | ||
|---|---|---|---|---|
| CAS Number | 90396-07-9 | Molecular Weight | 246.28200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4,4-dioxo-2,3-dihydrobenzo[f]thiochromen-1-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H10O3S |
|---|---|
| Molecular Weight | 246.28200 |
| Exact Mass | 246.03500 |
| PSA | 59.59000 |
| LogP | 3.28070 |
| InChIKey | FUVPSESXICVCQD-UHFFFAOYSA-N |
| SMILES | O=C1CCS(=O)(=O)c2ccc3ccccc3c21 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
4,4-dioxo-2,3-d... CAS#:90396-07-9 |
| Literature: Tarbell et al. Journal of the American Chemical Society, 1953 , vol. 75, p. 1985 |
|
~%
4,4-dioxo-2,3-d... CAS#:90396-07-9 |
| Literature: Tarbell et al. Journal of the American Chemical Society, 1953 , vol. 75, p. 1985 |
|
~%
4,4-dioxo-2,3-d... CAS#:90396-07-9 |
| Literature: Tarbell et al. Journal of the American Chemical Society, 1953 , vol. 75, p. 1985 |
![2,3-dihydrobenzo[f]thiochromen-1-one structure](https://image.chemsrc.com/caspic/467/3528-20-9.png)
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1H-Naphtho[2,1-b]thiopyran-1-one,2,3-dihydro-,4,4-dioxide |
| 5,6-benzothiochromanone-S,S-dioxide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 4,4-dioxo-2,3-dihydrobenzo[f]thiochromen-1-one? |
| A: The English name of 4,4-dioxo-2,3-dihydrobenzo[f]thiochromen-1-one is 4,4-dioxo-2,3-dihydrobenzo[f]thiochromen-1-one. |
| Q: What is the LogP of 4,4-dioxo-2,3-dihydrobenzo[f]thiochromen-1-one? |
| A: LogP of 4,4-dioxo-2,3-dihydrobenzo[f]thiochromen-1-one is 3.28070. |
| Q: What is the InChIKey of 4,4-dioxo-2,3-dihydrobenzo[f]thiochromen-1-one? |
| A: InChIKey of 4,4-dioxo-2,3-dihydrobenzo[f]thiochromen-1-one is FUVPSESXICVCQD-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 90396-07-9? |
| A: Chinese name of 90396-07-9 is 90396-07-9. |
| Q: What is the CAS number of 4,4-dioxo-2,3-dihydrobenzo[f]thiochromen-1-one? |
| A: CAS number of 4,4-dioxo-2,3-dihydrobenzo[f]thiochromen-1-one is 90396-07-9. |
| Q: What is the molecular formula of 4,4-dioxo-2,3-dihydrobenzo[f]thiochromen-1-one? |
| A: Molecular formula of 4,4-dioxo-2,3-dihydrobenzo[f]thiochromen-1-one is C13H10O3S. |
| Q: What is the molecular weight of 4,4-dioxo-2,3-dihydrobenzo[f]thiochromen-1-one? |
| A: Molecular weight of 4,4-dioxo-2,3-dihydrobenzo[f]thiochromen-1-one is 246.28200. |
| Q: What is the SMILES notation of 4,4-dioxo-2,3-dihydrobenzo[f]thiochromen-1-one? |
| A: SMILES notation of 4,4-dioxo-2,3-dihydrobenzo[f]thiochromen-1-one is O=C1CCS(=O)(=O)c2ccc3ccccc3c21. |
| Q: What English synonyms does 4,4-dioxo-2,3-dihydrobenzo[f]thiochromen-1-one have? |
| A: English synonyms of 4,4-dioxo-2,3-dihydrobenzo[f]thiochromen-1-one: 1H-Naphtho[2,1-b]thiopyran-1-one,2,3-dihydro-,4,4-dioxide, 5,6-benzothiochromanone-S,S-dioxide. |
| Q: What is the polar surface area (PSA) of 4,4-dioxo-2,3-dihydrobenzo[f]thiochromen-1-one? |
| A: Polar surface area (PSA) of 4,4-dioxo-2,3-dihydrobenzo[f]thiochromen-1-one is 59.59000. |