Benzenamine,N,N'-(1,4-phenylenedimethylidyne)bis[4-chloro- structure
|
Common Name | Benzenamine,N,N'-(1,4-phenylenedimethylidyne)bis[4-chloro- | ||
|---|---|---|---|---|
| CAS Number | 904-70-1 | Molecular Weight | 353.24500 | |
| Density | 1.18g/cm3 | Boiling Point | 513.4ºC at 760 mmHg | |
| Molecular Formula | C20H14Cl2N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 264.3ºC | |
| Name | N-(4-chlorophenyl)-1-[4-[(4-chlorophenyl)iminomethyl]phenyl]methanimine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 513.4ºC at 760 mmHg |
| Molecular Formula | C20H14Cl2N2 |
| Molecular Weight | 353.24500 |
| Flash Point | 264.3ºC |
| Exact Mass | 352.05300 |
| PSA | 24.72000 |
| LogP | 6.49460 |
| Index of Refraction | 1.605 |
| InChIKey | ITCBZDBGGMJBQB-UHFFFAOYSA-N |
| SMILES | Clc1ccc(N=Cc2ccc(C=Nc3ccc(Cl)cc3)cc2)cc1 |
| HS Code | 2921590090 |
|---|
|
~90%
Benzenamine,N,N... CAS#:904-70-1 |
| Literature: Li, Hao; Han, Ying-Feng; Jin, Guo-Xin Dalton Transactions, 2011 , vol. 40, # 18 p. 4982 - 4993 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2921590090 |
|---|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Terephthalaldehyd-bis-(4-chlor-phenylimin) |
| terephthalaldehyde bis-(4-chloro-phenylimine) |
| 1,4-bis<(4-chlorophenyl)iminomethyl>benzene |