ethyl 5-oxo-5,6,7,8-tetrahydronaphthalene-2-carboxylate structure
|
Common Name | ethyl 5-oxo-5,6,7,8-tetrahydronaphthalene-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 90401-85-7 | Molecular Weight | 218.24800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 5-oxo-7,8-dihydro-6H-naphthalene-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H14O3 |
|---|---|
| Molecular Weight | 218.24800 |
| Exact Mass | 218.09400 |
| PSA | 43.37000 |
| LogP | 2.38230 |
| InChIKey | XNXPDMGFXHBLHK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc2c(c1)CCCC2=O |
| HS Code | 2918300090 |
|---|
|
~63%
ethyl 5-oxo-5,6... CAS#:90401-85-7 |
| Literature: Itoh; Miyake; Tada; Hirata; Oka Chemical and Pharmaceutical Bulletin, 1984 , vol. 32, # 1 p. 130 - 151 |
|
~%
ethyl 5-oxo-5,6... CAS#:90401-85-7 |
| Literature: Itoh; Miyake; Tada; Hirata; Oka Chemical and Pharmaceutical Bulletin, 1984 , vol. 32, # 1 p. 130 - 151 |
|
~%
ethyl 5-oxo-5,6... CAS#:90401-85-7 |
| Literature: Itoh; Miyake; Tada; Hirata; Oka Chemical and Pharmaceutical Bulletin, 1984 , vol. 32, # 1 p. 130 - 151 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2-Naphthalenecarboxylic acid,5,6,7,8-tetrahydro-5-oxo-,ethyl ester |
| ethyl 5-oxo-5,6,7,8-tetrahydronaphthalene-2-carboxylate |
| ethyl 1-oxo-1,2,3,4-tetrahydro-6-naphthoate |
| ethyl 5-oxo-5,6,7,8-tetrahydro-2-naphthalenecarboxylate |