2,3,3,4,4,5,5,6,6-nonafluorocyclohexene-1-carbonitrile structure
|
Common Name | 2,3,3,4,4,5,5,6,6-nonafluorocyclohexene-1-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 90408-45-0 | Molecular Weight | 269.06700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7F9N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,3,3,4,4,5,5,6,6-nonafluorocyclohexene-1-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7F9N |
|---|---|
| Molecular Weight | 269.06700 |
| Exact Mass | 268.98900 |
| PSA | 23.79000 |
| LogP | 3.28838 |
| InChIKey | JKPUXUPVYPYSJO-UHFFFAOYSA-N |
| SMILES | N#CC1=C(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
|
~%
2,3,3,4,4,5,5,6... CAS#:90408-45-0 |
| Literature: Phull, Gurjeet S.; Plevey, Raymond G.; Rendell, Richard W.; Tatlow, John Colin Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1980 , p. 1507 - 1511 |
| nonafluorocyclohex-1-enecarbonitrile |
| 1-Cyclohexene-1-carbonitrile,2,3,3,4,4,5,5,6,6-nonafluoro |
| nonafluorocyclohexenecarbonitrile |