2,3,3,4,4,5,5,6,6-nonafluorocyclohexene-1-carbonitrile
2,3,3,4,4,5,5,6,6-nonafluorocyclohexene-1-carbonitrile structure
|
Common Name | 2,3,3,4,4,5,5,6,6-nonafluorocyclohexene-1-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 90408-45-0 | Molecular Weight | 269.06700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7F9N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,3,3,4,4,5,5,6,6-nonafluorocyclohexene-1-carbonitrile |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7F9N |
|---|---|
| Molecular Weight | 269.06700 |
| Exact Mass | 268.98900 |
| PSA | 23.79000 |
| LogP | 3.28838 |
| InChIKey | JKPUXUPVYPYSJO-UHFFFAOYSA-N |
| SMILES | N#CC1=C(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2,3,3,4,4,5,5,6... CAS#:90408-45-0 |
| Literature: Phull, Gurjeet S.; Plevey, Raymond G.; Rendell, Richard W.; Tatlow, John Colin Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1980 , p. 1507 - 1511 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| nonafluorocyclohex-1-enecarbonitrile |
| 1-Cyclohexene-1-carbonitrile,2,3,3,4,4,5,5,6,6-nonafluoro |
| nonafluorocyclohexenecarbonitrile |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 2,3,3,4,4,5,5,6,6-nonafluorocyclohexene-1-carbonitrile? |
| A: Polar surface area (PSA) of 2,3,3,4,4,5,5,6,6-nonafluorocyclohexene-1-carbonitrile is 23.79000. |
| Q: What is the molecular formula of 2,3,3,4,4,5,5,6,6-nonafluorocyclohexene-1-carbonitrile? |
| A: Molecular formula of 2,3,3,4,4,5,5,6,6-nonafluorocyclohexene-1-carbonitrile is C7F9N. |
| Q: What is the Chinese name of 90408-45-0? |
| A: Chinese name of 90408-45-0 is 90408-45-0. |
| Q: What is the SMILES notation of 2,3,3,4,4,5,5,6,6-nonafluorocyclohexene-1-carbonitrile? |
| A: SMILES notation of 2,3,3,4,4,5,5,6,6-nonafluorocyclohexene-1-carbonitrile is N#CC1=C(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F. |
| Q: What is the English name of 2,3,3,4,4,5,5,6,6-nonafluorocyclohexene-1-carbonitrile? |
| A: The English name of 2,3,3,4,4,5,5,6,6-nonafluorocyclohexene-1-carbonitrile is 2,3,3,4,4,5,5,6,6-nonafluorocyclohexene-1-carbonitrile. |
| Q: What is the CAS number of 2,3,3,4,4,5,5,6,6-nonafluorocyclohexene-1-carbonitrile? |
| A: CAS number of 2,3,3,4,4,5,5,6,6-nonafluorocyclohexene-1-carbonitrile is 90408-45-0. |
| Q: What English synonyms does 2,3,3,4,4,5,5,6,6-nonafluorocyclohexene-1-carbonitrile have? |
| A: English synonyms of 2,3,3,4,4,5,5,6,6-nonafluorocyclohexene-1-carbonitrile: nonafluorocyclohex-1-enecarbonitrile, 1-Cyclohexene-1-carbonitrile,2,3,3,4,4,5,5,6,6-nonafluoro, nonafluorocyclohexenecarbonitrile. |
| Q: What is the molecular weight of 2,3,3,4,4,5,5,6,6-nonafluorocyclohexene-1-carbonitrile? |
| A: Molecular weight of 2,3,3,4,4,5,5,6,6-nonafluorocyclohexene-1-carbonitrile is 269.06700. |
| Q: What is the InChIKey of 2,3,3,4,4,5,5,6,6-nonafluorocyclohexene-1-carbonitrile? |
| A: InChIKey of 2,3,3,4,4,5,5,6,6-nonafluorocyclohexene-1-carbonitrile is JKPUXUPVYPYSJO-UHFFFAOYSA-N. |
| Q: What is the LogP of 2,3,3,4,4,5,5,6,6-nonafluorocyclohexene-1-carbonitrile? |
| A: LogP of 2,3,3,4,4,5,5,6,6-nonafluorocyclohexene-1-carbonitrile is 3.28838. |