5,7-Dibromo-1-benzofuran-2-carboxylicacid structure
|
Common Name | 5,7-Dibromo-1-benzofuran-2-carboxylicacid | ||
|---|---|---|---|---|
| CAS Number | 90415-17-1 | Molecular Weight | 319.93400 | |
| Density | 2.115g/cm3 | Boiling Point | 418.4ºC at 760mmHg | |
| Molecular Formula | C9H4Br2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.9ºC | |
| Name | 5,7-dibromo-1-benzofuran-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 2.115g/cm3 |
|---|---|
| Boiling Point | 418.4ºC at 760mmHg |
| Molecular Formula | C9H4Br2O3 |
| Molecular Weight | 319.93400 |
| Flash Point | 206.9ºC |
| Exact Mass | 317.85300 |
| PSA | 50.44000 |
| LogP | 3.65600 |
| Index of Refraction | 1.703 |
| InChIKey | PTCVMMBMRYJVFE-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc2cc(Br)cc(Br)c2o1 |
| HS Code | 2932999099 |
|---|
|
~%
5,7-Dibromo-1-b... CAS#:90415-17-1 |
| Literature: Simonis; Wenzel Chemische Berichte, 1900 , vol. 33, p. 422 Chemische Berichte, 1900 , vol. 33, p. 1961 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5,7-Dibrom-2-carboxy-cumaron |
| 5,7-dibromo-benzofuran-2-carboxylic acid |
| 5,7-Dibrom-benzofuran-2-carbonsaeure |