tert-butyl 4-(oxiran-2-ylmethyl)-3-phenylpiperazine-1-carboxylate structure
|
Common Name | tert-butyl 4-(oxiran-2-ylmethyl)-3-phenylpiperazine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 904815-90-3 | Molecular Weight | 318.41100 | |
| Density | 1.145g/cm3 | Boiling Point | 422.7ºC at 760mmHg | |
| Molecular Formula | C18H26N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.5ºC | |
| Name | tert-butyl 4-(oxiran-2-ylmethyl)-3-phenylpiperazine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.145g/cm3 |
|---|---|
| Boiling Point | 422.7ºC at 760mmHg |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.41100 |
| Flash Point | 209.5ºC |
| Exact Mass | 318.19400 |
| PSA | 45.31000 |
| LogP | 2.55500 |
| Index of Refraction | 1.548 |
| InChIKey | GYDXITAYUYSBAY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC2CO2)C(c2ccccc2)C1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| gl-0494 |
| 4-oxiranylmethyl-3-phenyl-piperazine-1-carboxylic acid tert-butyl ester |