2-(4-tert-butoxycarbonylamino-butylamino)-nicotinic acid
Modify Date: 2025-08-25 16:39:51
2-(4-tert-butoxycarbonylamino-butylamino)-nicotinic acid structure
|
Common Name | 2-(4-tert-butoxycarbonylamino-butylamino)-nicotinic acid | ||
|---|---|---|---|---|
| CAS Number | 904816-11-1 | Molecular Weight | 309.36100 | |
| Density | 1.194g/cm3 | Boiling Point | 521.4ºC at 760 mmHg | |
| Molecular Formula | C15H23N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 269.1ºC | |
| Name | 2-(4-tert-butoxycarbonylamino-butylamino)-nicotinic acid |
|---|
| Density | 1.194g/cm3 |
|---|---|
| Boiling Point | 521.4ºC at 760 mmHg |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.36100 |
| Flash Point | 269.1ºC |
| Exact Mass | 309.16900 |
| PSA | 100.55000 |
| LogP | 2.96050 |
| Index of Refraction | 1.556 |
| InChIKey | ZVDGSWORVIILDO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCCNc1ncccc1C(=O)O |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |