tert-butyl 2-methyl-5-phenylpiperazine-1-carboxylate
Modify Date: 2025-08-26 07:12:23
tert-butyl 2-methyl-5-phenylpiperazine-1-carboxylate structure
|
Common Name | tert-butyl 2-methyl-5-phenylpiperazine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 904816-67-7 | Molecular Weight | 276.37400 | |
| Density | 1.043g/cm3 | Boiling Point | 379.3ºC at 760 mmHg | |
| Molecular Formula | C16H24N2O2 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 183.2ºC | |
| Name | tert-butyl 2-methyl-5-phenylpiperazine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.043g/cm3 |
|---|---|
| Boiling Point | 379.3ºC at 760 mmHg |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.37400 |
| Flash Point | 183.2ºC |
| Exact Mass | 276.18400 |
| PSA | 41.57000 |
| LogP | 3.22320 |
| Index of Refraction | 1.51 |
| InChIKey | JCGKNAFPLNQLDQ-UHFFFAOYSA-N |
| SMILES | CC1CNC(c2ccccc2)CN1C(=O)OC(C)(C)C |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| GL-0537 |
| 2-Methyl-5-phenyl-piperazine-1-carboxylic acid tert-butyl ester |