tert-butyl 4-(1,2,4-triazol-1-ylmethyl)piperazine-1-carboxylate
Modify Date: 2025-09-12 10:31:00
tert-butyl 4-(1,2,4-triazol-1-ylmethyl)piperazine-1-carboxylate structure
|
Common Name | tert-butyl 4-(1,2,4-triazol-1-ylmethyl)piperazine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 904816-91-7 | Molecular Weight | 267.32700 | |
| Density | 1.23g/cm3 | Boiling Point | 397.2ºC at 760 mmHg | |
| Molecular Formula | C12H21N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194ºC | |
| Name | tert-butyl 4-(1,2,4-triazol-1-ylmethyl)piperazine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 397.2ºC at 760 mmHg |
| Molecular Formula | C12H21N5O2 |
| Molecular Weight | 267.32700 |
| Flash Point | 194ºC |
| Exact Mass | 267.17000 |
| PSA | 63.49000 |
| LogP | 0.66410 |
| Index of Refraction | 1.586 |
| InChIKey | RLXVCEBPWOADHO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(Cn2cncn2)CC1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-[1,2,4]Triazol-1-ylmethyl-piperazine-1-carboxylic acid tert-butyl ester |
| GL-0546 |