2-(4-nitrophenyl)-1H-benzimidazole-4-carboxylic acid structure
|
Common Name | 2-(4-nitrophenyl)-1H-benzimidazole-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 904817-17-0 | Molecular Weight | 283.23900 | |
| Density | 1.533g/cm3 | Boiling Point | 609.8ºC at 760mmHg | |
| Molecular Formula | C14H9N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 322.6ºC | |
| Name | 2-(4-nitrophenyl)-1H-benzimidazole-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.533g/cm3 |
|---|---|
| Boiling Point | 609.8ºC at 760mmHg |
| Molecular Formula | C14H9N3O4 |
| Molecular Weight | 283.23900 |
| Flash Point | 322.6ºC |
| Exact Mass | 283.05900 |
| PSA | 111.80000 |
| LogP | 3.35950 |
| Index of Refraction | 1.742 |
| InChIKey | DEOIUABBTFOUKH-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccc2[nH]c(-c3ccc([N+](=O)[O-])cc3)nc12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(4-Nitro-phenyl)-3H-benzoimidazole-4-carboxylic acid |
| 2-(3,4-DICHLOROPHENOXY)-N'-HYDROXYETHANIMIDAMIDE |
| 1H-Benzimidazole-7-carboxylicacid,2-(4-nitrophenyl) |
| GL-0555 |