6-[3-methyl-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]pyridine-3-carboxylic acid structure
|
Common Name | 6-[3-methyl-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]pyridine-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 904817-70-5 | Molecular Weight | 321.37200 | |
| Density | 1.209g/cm3 | Boiling Point | 499.3ºC at 760 mmHg | |
| Molecular Formula | C16H23N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 255.8ºC | |
| Name | 6-[3-methyl-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]pyridine-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.209g/cm3 |
|---|---|
| Boiling Point | 499.3ºC at 760 mmHg |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.37200 |
| Flash Point | 255.8ºC |
| Exact Mass | 321.16900 |
| PSA | 82.97000 |
| LogP | 2.22830 |
| Index of Refraction | 1.549 |
| InChIKey | OLQYDWGOSNEFKE-UHFFFAOYSA-N |
| SMILES | CC1CN(c2ccc(C(=O)O)cn2)CCN1C(=O)OC(C)(C)C |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-(5-carboxy-(pyridin-2-yl))-2-methyl-piperazine-1-carboxylic acid tert-butyl ester |
| gl-0317 |