3-amino-2-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]benzoic acid structure
|
Common Name | 3-amino-2-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 904818-03-7 | Molecular Weight | 321.37200 | |
| Density | 1.261g/cm3 | Boiling Point | 502.7ºC at 760 mmHg | |
| Molecular Formula | C16H23N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 257.8ºC | |
| Name | 3-amino-2-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.261g/cm3 |
|---|---|
| Boiling Point | 502.7ºC at 760 mmHg |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.37200 |
| Flash Point | 257.8ºC |
| Exact Mass | 321.16900 |
| PSA | 96.10000 |
| LogP | 2.60820 |
| Index of Refraction | 1.59 |
| InChIKey | CHBKMODFHYFFOC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2c(N)cccc2C(=O)O)CC1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| GL-0324 |
| 4-(2-Amino-6-carboxy-phenyl)-piperazine-1-carboxylic acid tert-butyl ester |