3,5-Dinitro[1,1a(2)-biphenyl]-2-yl pentanoate
Modify Date: 2026-09-27 04:19:25
![3,5-Dinitro[1,1a(2)-biphenyl]-2-yl pentanoate Structure](https://www.chemsrc.com/extcaspic/136/905-63-5.png)
3,5-Dinitro[1,1a(2)-biphenyl]-2-yl pentanoate structure
|
Common Name | 3,5-Dinitro[1,1a(2)-biphenyl]-2-yl pentanoate | ||
|---|---|---|---|---|
| CAS Number | 905-63-5 | Molecular Weight | 344.32 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H16N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,5-Dinitro[1,1a(2)-biphenyl]-2-yl pentanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H16N2O6 |
|---|---|
| Molecular Weight | 344.32 |
| InChIKey | JYVFGAGKWFYLHR-UHFFFAOYSA-N |
| SMILES | CCCCC(=O)Oc1c(-c2ccccc2)cc([N+](=O)[O-])cc1[N+](=O)[O-] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 3,5-Dinitro[1,1a(2)-biphenyl]-2-yl pentanoate? |
| A: Molecular weight of 3,5-Dinitro[1,1a(2)-biphenyl]-2-yl pentanoate is 344.32. |
| Q: What is the English name of 3,5-Dinitro[1,1a(2)-biphenyl]-2-yl pentanoate? |
| A: The English name of 3,5-Dinitro[1,1a(2)-biphenyl]-2-yl pentanoate is 3,5-Dinitro[1,1a(2)-biphenyl]-2-yl pentanoate. |
| Q: What is the SMILES notation of 3,5-Dinitro[1,1a(2)-biphenyl]-2-yl pentanoate? |
| A: SMILES notation of 3,5-Dinitro[1,1a(2)-biphenyl]-2-yl pentanoate is CCCCC(=O)Oc1c(-c2ccccc2)cc([N+](=O)[O-])cc1[N+](=O)[O-]. |
| Q: What is the Chinese name of 905-63-5? |
| A: Chinese name of 905-63-5 is 905-63-5. |
| Q: What is the InChIKey of 3,5-Dinitro[1,1a(2)-biphenyl]-2-yl pentanoate? |
| A: InChIKey of 3,5-Dinitro[1,1a(2)-biphenyl]-2-yl pentanoate is JYVFGAGKWFYLHR-UHFFFAOYSA-N. |
| Q: What is the CAS number of 3,5-Dinitro[1,1a(2)-biphenyl]-2-yl pentanoate? |
| A: CAS number of 3,5-Dinitro[1,1a(2)-biphenyl]-2-yl pentanoate is 905-63-5. |
| Q: What is the molecular formula of 3,5-Dinitro[1,1a(2)-biphenyl]-2-yl pentanoate? |
| A: Molecular formula of 3,5-Dinitro[1,1a(2)-biphenyl]-2-yl pentanoate is C17H16N2O6. |