2,4-Dihydroxy-3,5-dimethylbenzoic acid
Modify Date: 2026-07-05 11:35:02
2,4-Dihydroxy-3,5-dimethylbenzoic acid structure
|
Common Name | 2,4-Dihydroxy-3,5-dimethylbenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 90536-63-3 | Molecular Weight | 182.17 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H10O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,4-Dihydroxy-3,5-dimethylbenzoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H10O4 |
|---|---|
| Molecular Weight | 182.17 |
| InChIKey | DGSVFCYEUDKSOR-UHFFFAOYSA-N |
| SMILES | Cc1cc(C(=O)O)c(O)c(C)c1O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2,4-Dihydroxy-3,5-dimethylbenzoic acid? |
| A: CAS number of 2,4-Dihydroxy-3,5-dimethylbenzoic acid is 90536-63-3. |
| Q: What is the Chinese name of 90536-63-3? |
| A: Chinese name of 90536-63-3 is 90536-63-3. |
| Q: What is the English name of 2,4-Dihydroxy-3,5-dimethylbenzoic acid? |
| A: The English name of 2,4-Dihydroxy-3,5-dimethylbenzoic acid is 2,4-Dihydroxy-3,5-dimethylbenzoic acid. |
| Q: What is the molecular weight of 2,4-Dihydroxy-3,5-dimethylbenzoic acid? |
| A: Molecular weight of 2,4-Dihydroxy-3,5-dimethylbenzoic acid is 182.17. |
| Q: What is the InChIKey of 2,4-Dihydroxy-3,5-dimethylbenzoic acid? |
| A: InChIKey of 2,4-Dihydroxy-3,5-dimethylbenzoic acid is DGSVFCYEUDKSOR-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2,4-Dihydroxy-3,5-dimethylbenzoic acid? |
| A: SMILES notation of 2,4-Dihydroxy-3,5-dimethylbenzoic acid is Cc1cc(C(=O)O)c(O)c(C)c1O. |
| Q: What is the molecular formula of 2,4-Dihydroxy-3,5-dimethylbenzoic acid? |
| A: Molecular formula of 2,4-Dihydroxy-3,5-dimethylbenzoic acid is C9H10O4. |