N-[1-(3-fluorophenyl)-5-oxopyrrolidin-3-yl]-4-methylbenzene-1-sulfonamide
Modify Date: 2025-09-14 11:41:48
![N-[1-(3-fluorophenyl)-5-oxopyrrolidin-3-yl]-4-methylbenzene-1-sulfonamide Structure](https://www.chemsrc.com/extcaspic/071/905686-76-2.png)
N-[1-(3-fluorophenyl)-5-oxopyrrolidin-3-yl]-4-methylbenzene-1-sulfonamide structure
|
Common Name | N-[1-(3-fluorophenyl)-5-oxopyrrolidin-3-yl]-4-methylbenzene-1-sulfonamide | ||
|---|---|---|---|---|
| CAS Number | 905686-76-2 | Molecular Weight | 348.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H17FN2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-[1-(3-fluorophenyl)-5-oxopyrrolidin-3-yl]-4-methylbenzene-1-sulfonamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H17FN2O3S |
|---|---|
| Molecular Weight | 348.4 |
| InChIKey | QKYQVPDUXCBAHO-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)NC2CC(=O)N(c3cccc(F)c3)C2)cc1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: USP8 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 8
External Id: USP8 FAST DUB HTS Primary
|
|
Name: USP17 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 17 like family member 5
External Id: USP17 FAST DUB HTS Primary
|
|
Name: USP7 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 7
External Id: USP7 FAST DUB HTS Primary
|
|
Name: USP28 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 28
External Id: USP28 FAST DUB HTS Primary
|
|
Name: USP10 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 10
External Id: USP10 FAST DUB HTS Primary
|
|
Name: UCHL1 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin C-terminal hydrolase L1
External Id: UCHL1 FAST DUB HTS Primary
|
|
Name: OTUD3 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: OTU deubiquitinase 3
External Id: OTUD3 FAST DUB HTS Primary
|
|
Name: USP30 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 30
External Id: USP30 FAST DUB HTS Primary
|
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
Total 11, Current Page 1 of 2
1
2
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 905686-76-2? |
| A: Chinese name of 905686-76-2 is 905686-76-2. |
| Q: What is the SMILES notation of N-[1-(3-fluorophenyl)-5-oxopyrrolidin-3-yl]-4-methylbenzene-1-sulfonamide? |
| A: SMILES notation of N-[1-(3-fluorophenyl)-5-oxopyrrolidin-3-yl]-4-methylbenzene-1-sulfonamide is Cc1ccc(S(=O)(=O)NC2CC(=O)N(c3cccc(F)c3)C2)cc1. |
| Q: What is the InChIKey of N-[1-(3-fluorophenyl)-5-oxopyrrolidin-3-yl]-4-methylbenzene-1-sulfonamide? |
| A: InChIKey of N-[1-(3-fluorophenyl)-5-oxopyrrolidin-3-yl]-4-methylbenzene-1-sulfonamide is QKYQVPDUXCBAHO-UHFFFAOYSA-N. |
| Q: What is the CAS number of N-[1-(3-fluorophenyl)-5-oxopyrrolidin-3-yl]-4-methylbenzene-1-sulfonamide? |
| A: CAS number of N-[1-(3-fluorophenyl)-5-oxopyrrolidin-3-yl]-4-methylbenzene-1-sulfonamide is 905686-76-2. |
| Q: What is the molecular formula of N-[1-(3-fluorophenyl)-5-oxopyrrolidin-3-yl]-4-methylbenzene-1-sulfonamide? |
| A: Molecular formula of N-[1-(3-fluorophenyl)-5-oxopyrrolidin-3-yl]-4-methylbenzene-1-sulfonamide is C17H17FN2O3S. |
| Q: What is the English name of N-[1-(3-fluorophenyl)-5-oxopyrrolidin-3-yl]-4-methylbenzene-1-sulfonamide? |
| A: The English name of N-[1-(3-fluorophenyl)-5-oxopyrrolidin-3-yl]-4-methylbenzene-1-sulfonamide is N-[1-(3-fluorophenyl)-5-oxopyrrolidin-3-yl]-4-methylbenzene-1-sulfonamide. |
| Q: What is the molecular weight of N-[1-(3-fluorophenyl)-5-oxopyrrolidin-3-yl]-4-methylbenzene-1-sulfonamide? |
| A: Molecular weight of N-[1-(3-fluorophenyl)-5-oxopyrrolidin-3-yl]-4-methylbenzene-1-sulfonamide is 348.4. |