3-amino-4-chloro-N,N-diethylbenzamide structure
|
Common Name | 3-amino-4-chloro-N,N-diethylbenzamide | ||
|---|---|---|---|---|
| CAS Number | 905811-02-1 | Molecular Weight | 226.70300 | |
| Density | 1.181g/cm3 | Boiling Point | 395.968ºC at 760 mmHg | |
| Molecular Formula | C11H15ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.275ºC | |
| Name | 3-amino-4-chloro-N,N-diethylbenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.181g/cm3 |
|---|---|
| Boiling Point | 395.968ºC at 760 mmHg |
| Molecular Formula | C11H15ClN2O |
| Molecular Weight | 226.70300 |
| Flash Point | 193.275ºC |
| Exact Mass | 226.08700 |
| PSA | 46.33000 |
| LogP | 2.98540 |
| Index of Refraction | 1.571 |
| InChIKey | UEVFJJAHTBFKAO-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)c1ccc(Cl)c(N)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-Amino-4-chloro-N,N-diethyl-benzamide |