3-(5-chloro-2-methylanilino)-3-oxopropanoic acid structure
|
Common Name | 3-(5-chloro-2-methylanilino)-3-oxopropanoic acid | ||
|---|---|---|---|---|
| CAS Number | 905811-05-4 | Molecular Weight | 227.64400 | |
| Density | 1.406g/cm3 | Boiling Point | 452.002ºC at 760 mmHg | |
| Molecular Formula | C10H10ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.163ºC | |
| Name | 3-(5-chloro-2-methylanilino)-3-oxopropanoic acid |
|---|
| Density | 1.406g/cm3 |
|---|---|
| Boiling Point | 452.002ºC at 760 mmHg |
| Molecular Formula | C10H10ClNO3 |
| Molecular Weight | 227.64400 |
| Flash Point | 227.163ºC |
| Exact Mass | 227.03500 |
| PSA | 66.40000 |
| LogP | 2.13460 |
| Index of Refraction | 1.614 |
| InChIKey | TUXXXTLXVKEGJC-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Cl)cc1NC(=O)CC(=O)O |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |