1-(2,4,5-TRICHLOROPHENYL)-2-THIOUREA structure
|
Common Name | 1-(2,4,5-TRICHLOROPHENYL)-2-THIOUREA | ||
|---|---|---|---|---|
| CAS Number | 90617-76-8 | Molecular Weight | 255.55200 | |
| Density | 1.665g/cm3 | Boiling Point | 346.1ºC at 760mmHg | |
| Molecular Formula | C7H5Cl3N2S | Melting Point | 178-180ºC | |
| MSDS | N/A | Flash Point | 163.1ºC | |
| Name | (2,4,5-trichlorophenyl)thiourea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.665g/cm3 |
|---|---|
| Boiling Point | 346.1ºC at 760mmHg |
| Melting Point | 178-180ºC |
| Molecular Formula | C7H5Cl3N2S |
| Molecular Weight | 255.55200 |
| Flash Point | 163.1ºC |
| Exact Mass | 253.92400 |
| PSA | 70.14000 |
| LogP | 4.07560 |
| Index of Refraction | 1.732 |
| InChIKey | MEDSQLVNGCCGMI-UHFFFAOYSA-N |
| SMILES | NC(=S)Nc1cc(Cl)c(Cl)cc1Cl |
| HS Code | 2930909090 |
|---|
|
~%
1-(2,4,5-TRICHL... CAS#:90617-76-8 |
| Literature: Journal of the Chemical Society, , p. 3043 |
|
~%
1-(2,4,5-TRICHL... CAS#:90617-76-8 |
| Literature: Journal of the Chemical Society, , p. 3043 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2,4,5-trichlorophenylthiourea |