1,3-Benzodioxole,5-[1-(4-fluorophenyl)ethyl]-6-methoxy- structure
|
Common Name | 1,3-Benzodioxole,5-[1-(4-fluorophenyl)ethyl]-6-methoxy- | ||
|---|---|---|---|---|
| CAS Number | 90632-71-6 | Molecular Weight | 274.28700 | |
| Density | 1.216g/cm3 | Boiling Point | 367.8ºC at 760mmHg | |
| Molecular Formula | C16H15FO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.6ºC | |
| Name | 5-[1-(4-fluorophenyl)ethyl]-6-methoxy-1,3-benzodioxole |
|---|
| Density | 1.216g/cm3 |
|---|---|
| Boiling Point | 367.8ºC at 760mmHg |
| Molecular Formula | C16H15FO3 |
| Molecular Weight | 274.28700 |
| Flash Point | 184.6ºC |
| Exact Mass | 274.10100 |
| PSA | 27.69000 |
| LogP | 3.71480 |
| Index of Refraction | 1.561 |
| InChIKey | DUXHDPMGAMLDGV-UHFFFAOYSA-N |
| SMILES | COc1cc2c(cc1C(C)c1ccc(F)cc1)OCO2 |
|
~%
1,3-Benzodioxol... CAS#:90632-71-6 |
| Literature: Jurd; Narayanan; Paull Journal of Medicinal Chemistry, 1987 , vol. 30, # 10 p. 1752 - 1756 |
|
~%
1,3-Benzodioxol... CAS#:90632-71-6 |
| Literature: Jurd; Narayanan; Paull Journal of Medicinal Chemistry, 1987 , vol. 30, # 10 p. 1752 - 1756 |
|
~%
1,3-Benzodioxol... CAS#:90632-71-6 |
| Literature: Jurd; Narayanan; Paull Journal of Medicinal Chemistry, 1987 , vol. 30, # 10 p. 1752 - 1756 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |