Valparicine
Modify Date: 2026-05-27 11:41:43
Valparicine structure
|
Common Name | Valparicine | ||
|---|---|---|---|---|
| CAS Number | 906348-22-9 | Molecular Weight | 276.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H20N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Valparicine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H20N2 |
|---|---|
| Molecular Weight | 276.4 |
| InChIKey | KFXIUXCXSKTCNK-ZKHUDAJZSA-N |
| SMILES | C/C=C\1/CN2CC[C@@]34[C@@H]2C[C@@H]1C(=C)C3=NC5=CC=CC=C45 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Cytotoxicity against vincristine-sensitive human KB cells
Source: ChEMBL
Target: KB
External Id: CHEMBL925343
|
|
Name: Cytotoxicity against vincristine-resistant human KB/VJ300 cells
Source: ChEMBL
Target: NON-PROTEIN TARGET
External Id: CHEMBL925344
|
|
Name: Cytotoxicity against vincristine-resistant human KB/VJ300 cells in presence of 0.1 ug...
Source: ChEMBL
Target: NON-PROTEIN TARGET
External Id: CHEMBL925345
|
|
Name: Cytotoxicity against human Jurkat cells
Source: ChEMBL
Target: Jurkat
External Id: CHEMBL925346
|
Total 4, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 906348-22-9? |
| A: Chinese name of 906348-22-9 is 906348-22-9. |
| Q: What is the CAS number of Valparicine? |
| A: CAS number of Valparicine is 906348-22-9. |
| Q: What is the English name of Valparicine? |
| A: The English name of Valparicine is Valparicine. |
| Q: What is the molecular weight of Valparicine? |
| A: Molecular weight of Valparicine is 276.4. |
| Q: What is the SMILES notation of Valparicine? |
| A: SMILES notation of Valparicine is C/C=C\1/CN2CC[C@@]34[C@@H]2C[C@@H]1C(=C)C3=NC5=CC=CC=C45. |
| Q: What is the InChIKey of Valparicine? |
| A: InChIKey of Valparicine is KFXIUXCXSKTCNK-ZKHUDAJZSA-N. |
| Q: What is the molecular formula of Valparicine? |
| A: Molecular formula of Valparicine is C19H20N2. |