ethyl 3-(6-methylpyrazin-2-yl)oxybenzoate structure
|
Common Name | ethyl 3-(6-methylpyrazin-2-yl)oxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 906352-99-6 | Molecular Weight | 258.27300 | |
| Density | 1.189g/cm3 | Boiling Point | 380.9ºC at 760mmHg | |
| Molecular Formula | C14H14N2O3 | Melting Point | 50.5-51.5ºC | |
| MSDS | N/A | Flash Point | 184.1ºC | |
| Name | ethyl 3-(6-methylpyrazin-2-yl)oxybenzoate |
|---|
| Density | 1.189g/cm3 |
|---|---|
| Boiling Point | 380.9ºC at 760mmHg |
| Melting Point | 50.5-51.5ºC |
| Molecular Formula | C14H14N2O3 |
| Molecular Weight | 258.27300 |
| Flash Point | 184.1ºC |
| Exact Mass | 258.10000 |
| PSA | 61.31000 |
| LogP | 2.75400 |
| Index of Refraction | 1.559 |
| InChIKey | ALDBUDYDJSLBJO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cccc(Oc2cncc(C)n2)c1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |