3-amino-7-bromonaphthalene-2-carboxylic acid structure
|
Common Name | 3-amino-7-bromonaphthalene-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 906545-99-1 | Molecular Weight | 266.09100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H8BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-amino-7-bromonaphthalene-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H8BrNO2 |
|---|---|
| Molecular Weight | 266.09100 |
| Exact Mass | 264.97400 |
| PSA | 63.32000 |
| LogP | 3.46390 |
| InChIKey | SRLLGPNRHHLCIM-UHFFFAOYSA-N |
| SMILES | Nc1cc2ccc(Br)cc2cc1C(=O)O |
|
~%
3-amino-7-bromo... CAS#:906545-99-1 |
| Literature: Lee, Alex H. F.; Kool, Eric T. Journal of the American Chemical Society, 2006 , vol. 128, # 28 p. 9219 - 9230 |
|
~91%
3-amino-7-bromo... CAS#:906545-99-1 |
| Literature: Bristol-Myers Squibb Company Patent: US2010/80770 A1, 2010 ; US 20100080770 A1 |
| 3-AMINO-7-BROMO-2-NAPHTHOIC ACID |
| 3-amino-7-dibromonaphthalene-2-carboxylic acid |