4,6-Dichloro-2-(methylthio)-7H-pyrrolo[2,3-d]pyrimidine structure
|
Common Name | 4,6-Dichloro-2-(methylthio)-7H-pyrrolo[2,3-d]pyrimidine | ||
|---|---|---|---|---|
| CAS Number | 90662-12-7 | Molecular Weight | 234.106 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 449.4±55.0 °C at 760 mmHg | |
| Molecular Formula | C7H5Cl2N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.6±31.5 °C | |
| Name | 4,6-dichloro-2-methylsulfanyl-7H-pyrrolo[2,3-d]pyrimidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 449.4±55.0 °C at 760 mmHg |
| Molecular Formula | C7H5Cl2N3S |
| Molecular Weight | 234.106 |
| Flash Point | 225.6±31.5 °C |
| Exact Mass | 232.958130 |
| PSA | 66.87000 |
| LogP | 3.40 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.719 |
| InChIKey | AYLKWJLSXAICBZ-UHFFFAOYSA-N |
| SMILES | CSc1nc(Cl)c2cc(Cl)[nH]c2n1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,6-Dichloro-2-(methylsulfanyl)-7H-pyrrolo[2,3-d]pyrimidine |
| 7H-pyrrolo[2,3-d]pyrimidine, 4,6-dichloro-2-(methylthio)- |