5-(PYRIDIN-4-YL)-1H-INDOLE structure
|
Common Name | 5-(PYRIDIN-4-YL)-1H-INDOLE | ||
|---|---|---|---|---|
| CAS Number | 90679-35-9 | Molecular Weight | 194.23200 | |
| Density | 1.211g/cm3 | Boiling Point | 405.128ºC at 760 mmHg | |
| Molecular Formula | C13H10N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.355ºC | |
| Name | 5-pyridin-4-yl-1h-indole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.211g/cm3 |
|---|---|
| Boiling Point | 405.128ºC at 760 mmHg |
| Molecular Formula | C13H10N2 |
| Molecular Weight | 194.23200 |
| Flash Point | 184.355ºC |
| Exact Mass | 194.08400 |
| PSA | 28.68000 |
| LogP | 3.22990 |
| Index of Refraction | 1.689 |
| InChIKey | FRUSCDHKJYONLE-UHFFFAOYSA-N |
| SMILES | c1cc(-c2ccc3[nH]ccc3c2)ccn1 |
| HS Code | 2933990090 |
|---|
|
~61%
5-(PYRIDIN-4-YL... CAS#:90679-35-9 |
| Literature: H. LUNDBECK A/S Patent: WO2007/19867 A1, 2007 ; Location in patent: Page/Page column 21-22 ; WO 2007/019867 A1 |
|
~65%
5-(PYRIDIN-4-YL... CAS#:90679-35-9 |
| Literature: Yang, Youhua; Martin, Arnold R. Heterocycles, 1992 , vol. 34, # 7 p. 1395 - 1398 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-INDOLE,5-(4-PYRIDINYL) |
| 5-(4-PYRIDINYL)-1H-INDOLE |
| 5-(Pyridin-4-yl)-1H-indole |
| 5-(4-pyridyl)indole |