5-(butylamino)-4-nitrothiophene-2-carbonitrile structure
|
Common Name | 5-(butylamino)-4-nitrothiophene-2-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 90732-84-6 | Molecular Weight | 225.26800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H11N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(butylamino)-4-nitrothiophene-2-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H11N3O2S |
|---|---|
| Molecular Weight | 225.26800 |
| Exact Mass | 225.05700 |
| PSA | 109.88000 |
| LogP | 3.33618 |
| InChIKey | HUZGHZVXXAIYII-UHFFFAOYSA-N |
| SMILES | CCCCNc1sc(C#N)cc1[N+](=O)[O-] |
|
~%
5-(butylamino)-... CAS#:90732-84-6 |
| Literature: Consiglio, Giovanni; Arnone, Caterina; Spinelli, Domenico; Noto, Renato; Frenna, Vincenzo Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1984 , # 4 p. 781 - 784 |
| 2-Thiophenecarbonitrile,5-(butylamino)-4-nitro |