5-[2-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)ethyl]-3H-1,3,4-oxadiazole-2-thione structure
|
Common Name | 5-[2-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)ethyl]-3H-1,3,4-oxadiazole-2-thione | ||
|---|---|---|---|---|
| CAS Number | 90748-73-5 | Molecular Weight | 230.26700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H6N4O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-[2-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)ethyl]-3H-1,3,4-oxadiazole-2-thione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H6N4O2S2 |
|---|---|
| Molecular Weight | 230.26700 |
| Exact Mass | 229.99300 |
| PSA | 155.44000 |
| LogP | 0.81520 |
| InChIKey | GGZKYLBYPGOGLL-UHFFFAOYSA-N |
| SMILES | S=c1[nH]nc(CCc2n[nH]c(=S)o2)o1 |
|
~63%
5-[2-(2-sulfany... CAS#:90748-73-5 |
| Literature: Mishra, V. K.; Bahel, S. C. Journal of the Indian Chemical Society, 1983 , vol. 60, p. 867 - 870 |
| 1,3,4-Oxadiazole-2(3H)-thione,5,5'-(1,2-ethanediyl)bis |
| 1,2[di-(2-mercapto-1,3,4-oxadiazole-5-yl)]ethane |
| bis-(5-mercapto-1,3,4-oxadiazol-2-yl)-ethane |