1-Allyl-6-amino-3-methyl-5-nitroso-2,4(1H,3H)-pyrimidinedione structure
|
Common Name | 1-Allyl-6-amino-3-methyl-5-nitroso-2,4(1H,3H)-pyrimidinedione | ||
|---|---|---|---|---|
| CAS Number | 90749-76-1 | Molecular Weight | 210.19000 | |
| Density | 1.43g/cm3 | Boiling Point | 275.9ºC at 760 mmHg | |
| Molecular Formula | C8H10N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 120.6ºC | |
| Name | 6-amino-3-methyl-5-nitroso-1-prop-2-enylpyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.43g/cm3 |
|---|---|
| Boiling Point | 275.9ºC at 760 mmHg |
| Molecular Formula | C8H10N4O3 |
| Molecular Weight | 210.19000 |
| Flash Point | 120.6ºC |
| Exact Mass | 210.07500 |
| PSA | 99.45000 |
| LogP | 0.29430 |
| Index of Refraction | 1.629 |
| InChIKey | JHDCESCAFVJTGE-UHFFFAOYSA-N |
| SMILES | C=CCn1c(N)c(N=O)c(=O)n(C)c1=O |
|
~%
1-Allyl-6-amino... CAS#:90749-76-1 |
| Literature: Wells; Garst; Kramer Journal of Medicinal Chemistry, 1981 , vol. 24, # 8 p. 954 - 958 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1-allyl-3-methyl-5-nitroso-6-amino uracil |