Methyl 2-chloro-4,4-dimethoxy-3-oxopentanoate
Modify Date: 2026-09-22 17:44:51
Methyl 2-chloro-4,4-dimethoxy-3-oxopentanoate structure
|
Common Name | Methyl 2-chloro-4,4-dimethoxy-3-oxopentanoate | ||
|---|---|---|---|---|
| CAS Number | 907545-59-9 | Molecular Weight | 224.64 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H13ClO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 2-chloro-4,4-dimethoxy-3-oxopentanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H13ClO5 |
|---|---|
| Molecular Weight | 224.64 |
| InChIKey | QVCWYDSSUMABKM-UHFFFAOYSA-N |
| SMILES | COC(=O)C(Cl)C(=O)C(C)(OC)OC |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Methyl 2-chloro-4,4-dimethoxy-3-oxopentanoate? |
| A: Molecular formula of Methyl 2-chloro-4,4-dimethoxy-3-oxopentanoate is C8H13ClO5. |
| Q: What is the English name of Methyl 2-chloro-4,4-dimethoxy-3-oxopentanoate? |
| A: The English name of Methyl 2-chloro-4,4-dimethoxy-3-oxopentanoate is Methyl 2-chloro-4,4-dimethoxy-3-oxopentanoate. |
| Q: What is the InChIKey of Methyl 2-chloro-4,4-dimethoxy-3-oxopentanoate? |
| A: InChIKey of Methyl 2-chloro-4,4-dimethoxy-3-oxopentanoate is QVCWYDSSUMABKM-UHFFFAOYSA-N. |
| Q: What is the CAS number of Methyl 2-chloro-4,4-dimethoxy-3-oxopentanoate? |
| A: CAS number of Methyl 2-chloro-4,4-dimethoxy-3-oxopentanoate is 907545-59-9. |
| Q: What is the molecular weight of Methyl 2-chloro-4,4-dimethoxy-3-oxopentanoate? |
| A: Molecular weight of Methyl 2-chloro-4,4-dimethoxy-3-oxopentanoate is 224.64. |
| Q: What is the Chinese name of 907545-59-9? |
| A: Chinese name of 907545-59-9 is 907545-59-9. |
| Q: What is the SMILES notation of Methyl 2-chloro-4,4-dimethoxy-3-oxopentanoate? |
| A: SMILES notation of Methyl 2-chloro-4,4-dimethoxy-3-oxopentanoate is COC(=O)C(Cl)C(=O)C(C)(OC)OC. |