4,6-dinitronaphthalen-1-amine
Modify Date: 2026-07-15 18:38:48
4,6-dinitronaphthalen-1-amine structure
|
Common Name | 4,6-dinitronaphthalen-1-amine | ||
|---|---|---|---|---|
| CAS Number | 90765-72-3 | Molecular Weight | 233.18000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H7N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4,6-dinitronaphthalen-1-amine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H7N3O4 |
|---|---|
| Molecular Weight | 233.18000 |
| Exact Mass | 233.04400 |
| PSA | 117.66000 |
| LogP | 3.86600 |
| InChIKey | BQJJQMSZJQQLPD-UHFFFAOYSA-N |
| SMILES | Nc1ccc([N+](=O)[O-])c2cc([N+](=O)[O-])ccc12 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-Naphthalenamine,4,6-dinitro |
| 4,6-dinitro-[1]naphthylamine |
| 4.6-Dinitro-1-amino-naphthalin |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 4,6-dinitronaphthalen-1-amine? |
| A: Molecular weight of 4,6-dinitronaphthalen-1-amine is 233.18000. |
| Q: What is the polar surface area (PSA) of 4,6-dinitronaphthalen-1-amine? |
| A: Polar surface area (PSA) of 4,6-dinitronaphthalen-1-amine is 117.66000. |
| Q: What is the molecular formula of 4,6-dinitronaphthalen-1-amine? |
| A: Molecular formula of 4,6-dinitronaphthalen-1-amine is C10H7N3O4. |
| Q: What is the LogP of 4,6-dinitronaphthalen-1-amine? |
| A: LogP of 4,6-dinitronaphthalen-1-amine is 3.86600. |
| Q: What is the InChIKey of 4,6-dinitronaphthalen-1-amine? |
| A: InChIKey of 4,6-dinitronaphthalen-1-amine is BQJJQMSZJQQLPD-UHFFFAOYSA-N. |
| Q: What is the CAS number of 4,6-dinitronaphthalen-1-amine? |
| A: CAS number of 4,6-dinitronaphthalen-1-amine is 90765-72-3. |
| Q: What is the Chinese name of 90765-72-3? |
| A: Chinese name of 90765-72-3 is 90765-72-3. |
| Q: What is the SMILES notation of 4,6-dinitronaphthalen-1-amine? |
| A: SMILES notation of 4,6-dinitronaphthalen-1-amine is Nc1ccc([N+](=O)[O-])c2cc([N+](=O)[O-])ccc12. |
| Q: What English synonyms does 4,6-dinitronaphthalen-1-amine have? |
| A: English synonyms of 4,6-dinitronaphthalen-1-amine: 1-Naphthalenamine,4,6-dinitro, 4,6-dinitro-[1]naphthylamine, 4.6-Dinitro-1-amino-naphthalin. |
| Q: What is the English name of 4,6-dinitronaphthalen-1-amine? |
| A: The English name of 4,6-dinitronaphthalen-1-amine is 4,6-dinitronaphthalen-1-amine. |