4-[(2,4-Dichlorophenyl)methyl]-1,3-thiazol-2-amine
Modify Date: 2025-10-23 06:45:47
![4-[(2,4-Dichlorophenyl)methyl]-1,3-thiazol-2-amine Structure](https://www.chemsrc.com/extcaspic/198/90767-67-2.png)
4-[(2,4-Dichlorophenyl)methyl]-1,3-thiazol-2-amine structure
|
Common Name | 4-[(2,4-Dichlorophenyl)methyl]-1,3-thiazol-2-amine | ||
|---|---|---|---|---|
| CAS Number | 90767-67-2 | Molecular Weight | 259.15 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H8Cl2N2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-[(2,4-Dichlorophenyl)methyl]-1,3-thiazol-2-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H8Cl2N2S |
|---|---|
| Molecular Weight | 259.15 |
| InChIKey | PNEPXYRISUWLRT-UHFFFAOYSA-N |
| SMILES | Nc1nc(Cc2ccc(Cl)cc2Cl)cs1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 4-[(2,4-Dichlorophenyl)methyl]-1,3-thiazol-2-amine? |
| A: Molecular formula of 4-[(2,4-Dichlorophenyl)methyl]-1,3-thiazol-2-amine is C10H8Cl2N2S. |
| Q: What is the English name of 4-[(2,4-Dichlorophenyl)methyl]-1,3-thiazol-2-amine? |
| A: The English name of 4-[(2,4-Dichlorophenyl)methyl]-1,3-thiazol-2-amine is 4-[(2,4-Dichlorophenyl)methyl]-1,3-thiazol-2-amine. |
| Q: What is the InChIKey of 4-[(2,4-Dichlorophenyl)methyl]-1,3-thiazol-2-amine? |
| A: InChIKey of 4-[(2,4-Dichlorophenyl)methyl]-1,3-thiazol-2-amine is PNEPXYRISUWLRT-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 90767-67-2? |
| A: Chinese name of 90767-67-2 is 90767-67-2. |
| Q: What is the SMILES notation of 4-[(2,4-Dichlorophenyl)methyl]-1,3-thiazol-2-amine? |
| A: SMILES notation of 4-[(2,4-Dichlorophenyl)methyl]-1,3-thiazol-2-amine is Nc1nc(Cc2ccc(Cl)cc2Cl)cs1. |
| Q: What is the molecular weight of 4-[(2,4-Dichlorophenyl)methyl]-1,3-thiazol-2-amine? |
| A: Molecular weight of 4-[(2,4-Dichlorophenyl)methyl]-1,3-thiazol-2-amine is 259.15. |
| Q: What is the CAS number of 4-[(2,4-Dichlorophenyl)methyl]-1,3-thiazol-2-amine? |
| A: CAS number of 4-[(2,4-Dichlorophenyl)methyl]-1,3-thiazol-2-amine is 90767-67-2. |