2,4,6-Pyrimidinetriamine,N4-(4-bromophenyl)-5-nitroso- structure
|
Common Name | 2,4,6-Pyrimidinetriamine,N4-(4-bromophenyl)-5-nitroso- | ||
|---|---|---|---|---|
| CAS Number | 90772-47-7 | Molecular Weight | 309.12200 | |
| Density | 1.94g/cm3 | Boiling Point | 577.5ºC at 760mmHg | |
| Molecular Formula | C10H9BrN6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 303.1ºC | |
| Name | 2,4,6-Pyrimidinetriamine, N4-(4-bromophenyl)-5-nitroso |
|---|
| Density | 1.94g/cm3 |
|---|---|
| Boiling Point | 577.5ºC at 760mmHg |
| Molecular Formula | C10H9BrN6O |
| Molecular Weight | 309.12200 |
| Flash Point | 303.1ºC |
| Exact Mass | 308.00200 |
| PSA | 119.28000 |
| LogP | 3.78040 |
| Index of Refraction | 1.801 |
| InChIKey | CQNRHAOUJJONJK-UHFFFAOYSA-N |
| SMILES | Nc1nc(N)c(N=O)c(Nc2ccc(Br)cc2)n1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |